EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:747602 - isopropylcarbamic acid
| Formula | C4H9NO2 |
| Net Charge | 0 |
| Average Mass | 103.121 |
| Monoisotopic Mass | 103.06333 |
| SMILES | CC(C)NC(=O)O |
| InChI | InChI=1S/C4H9NO2/c1-3(2)5-4(6)7/h3,5H,1-2H3,(H,6,7) |
| InChIKey | KNTZCGBYFGEMFR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paenarthrobacter sp. YJN-5 (ncbitaxon:NCBITaxon:2735316) | - | PubMed (41721206) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isopropylcarbamic acid (CHEBI:747602) has functional parent carbamic acid (CHEBI:28616) |
| isopropylcarbamic acid (CHEBI:747602) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| isopropylcarbamic acid (CHEBI:747602) is a amino acid (CHEBI:33709) |
| IUPAC Name |
|---|
| propan-2-ylcarbamic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:504238 | PubChem Compound |
| Citations |
|---|