EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N5O13P3 |
| Net Charge | 0 |
| Average Mass | 507.182 |
| Monoisotopic Mass | 506.99575 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | ZKHQWZAMYRWXGA-KQYNXXCUSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. fundamental metabolite Any metabolite produced by all living cells. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ATP (CHEBI:15422) has role cofactor (CHEBI:23357) |
| ATP (CHEBI:15422) has role fundamental metabolite (CHEBI:78675) |
| ATP (CHEBI:15422) has role micronutrient (CHEBI:27027) |
| ATP (CHEBI:15422) has role nutraceutical (CHEBI:50733) |
| ATP (CHEBI:15422) is a adenosine 5'-phosphate (CHEBI:37096) |
| ATP (CHEBI:15422) is a purine ribonucleoside 5'-triphosphate (CHEBI:37045) |
| ATP (CHEBI:15422) is conjugate acid of ATP(3−) (CHEBI:57299) |
| Incoming Relation(s) |
| N6-(dimethylallyl)adenosine 5'-triphosphate (CHEBI:71679) has functional parent ATP (CHEBI:15422) |
| 2-hydroxy-ATP (CHEBI:65119) has functional parent ATP (CHEBI:15422) |
| 3'-dehydro-ATP (CHEBI:27782) has functional parent ATP (CHEBI:15422) |
| 8-hydroxy-ATP (CHEBI:189101) has functional parent ATP (CHEBI:15422) |
| 8-oxo-ATP (CHEBI:189100) has functional parent ATP (CHEBI:15422) |
| 9-ribosyl-trans-zeatin 5'-triphosphate (CHEBI:71938) has functional parent ATP (CHEBI:15422) |
| adenosine 5'-[γ-thio]triphosphate (CHEBI:27575) has functional parent ATP (CHEBI:15422) |
| adenosine thiamine triphosphate (CHEBI:71394) has functional parent ATP (CHEBI:15422) |
| ATP-sugar (CHEBI:20855) has functional parent ATP (CHEBI:15422) |
| ethyl-ATP (CHEBI:62910) has functional parent ATP (CHEBI:15422) |
| TNP-ATP (CHEBI:50104) has functional parent ATP (CHEBI:15422) |
| adenosine triphosphate disodium (CHEBI:50732) has part ATP (CHEBI:15422) |
| ATP(3−) (CHEBI:57299) is conjugate base of ATP (CHEBI:15422) |
| IUPAC Name |
|---|
| adenosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| Adenosine 5'-triphosphate | KEGG COMPOUND |
| ADENOSINE-5'-TRIPHOSPHATE | PDBeChem |
| Adenosine triphosphate | ChemIDplus |
| ATP | KEGG COMPOUND |
| H4atp | IUPAC |
| Brand Names | Source |
|---|---|
| Adephos | DrugBank |
| Adetol | DrugBank |
| Adynol | DrugBank |
| Atipi | DrugBank |
| Atriphos | DrugBank |
| Cardenosine | DrugBank |