EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N5O14P3 |
| Net Charge | 0 |
| Average Mass | 523.181 |
| Monoisotopic Mass | 522.99066 |
| SMILES | Nc1ncnc2c1nc(O)n2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16N5O14P3/c11-7-4-8(13-2-12-7)15(10(18)14-4)9-6(17)5(16)3(27-9)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,14,18)(H,22,23)(H,24,25)(H2,11,12,13)(H2,19,20,21)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | CAIHKAFUTAIAPY-UUOKFMHZSA-N |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-hydroxy-ATP (CHEBI:189101) has functional parent ATP (CHEBI:15422) |
| 8-hydroxy-ATP (CHEBI:189101) is a purine ribonucleoside 5'-triphosphate (CHEBI:37045) |
| 8-hydroxy-ATP (CHEBI:189101) is tautomer of 8-oxo-ATP (CHEBI:189100) |
| Incoming Relation(s) |
| 8-oxo-ATP (CHEBI:189100) is tautomer of 8-hydroxy-ATP (CHEBI:189101) |
| IUPAC Name |
|---|
| 8-hydroxyadenosine 5'-(tetrahydrogen triphosphate) |
| Synonym | Source |
|---|---|
| 8-hydroxyadenosine-5'-triphosphate | ChEBI |
| Citations |
|---|