EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N5O14P3 |
| Net Charge | 0 |
| Average Mass | 591.300 |
| Monoisotopic Mass | 591.05326 |
| SMILES | C/C(=C\CNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O)CO |
| InChI | InChI=1S/C15H24N5O14P3/c1-8(4-21)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(23)11(22)9(32-15)5-31-36(27,28)34-37(29,30)33-35(24,25)26/h2,6-7,9,11-12,15,21-23H,3-5H2,1H3,(H,27,28)(H,29,30)(H,16,17,18)(H2,24,25,26)/b8-2+/t9-,11-,12-,15-/m1/s1 |
| InChIKey | AOFQQLZNDSBFLN-HNNGNKQASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (15280363) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-ribosyl-trans-zeatin 5'-triphosphate (CHEBI:71938) has functional parent ATP (CHEBI:15422) |
| 9-ribosyl-trans-zeatin 5'-triphosphate (CHEBI:71938) has role plant metabolite (CHEBI:76924) |
| 9-ribosyl-trans-zeatin 5'-triphosphate (CHEBI:71938) is a N-glycosylzeatin (CHEBI:38645) |
| 9-ribosyl-trans-zeatin 5'-triphosphate (CHEBI:71938) is a adenosine 5'-phosphate (CHEBI:37096) |
| 9-ribosyl-trans-zeatin 5'-triphosphate (CHEBI:71938) is a purine ribonucleoside 5'-triphosphate (CHEBI:37045) |
| 9-ribosyl-trans-zeatin 5'-triphosphate (CHEBI:71938) is conjugate acid of 9-ribosyl-trans-zeatin 5'-triphosphate(4−) (CHEBI:87953) |
| Incoming Relation(s) |
| 9-ribosyl-trans-zeatin 5'-triphosphate(4−) (CHEBI:87953) is conjugate base of 9-ribosyl-trans-zeatin 5'-triphosphate (CHEBI:71938) |
| Synonyms | Source |
|---|---|
| 9-β-D-ribofuranosyl-trans-zeatin 5'-triphosphate | ChEBI |
| 9-β-D-ribosyl-trans-zeatin 5'-triphosphate | ChEBI |
| trans-zeatin 9-β-D-ribofuranoside 5'-triphosphate | ChEBI |
| trans-Zeatin riboside triphosphate | KEGG COMPOUND |
| tZRTP | MetaCyc |
| Citations |
|---|