EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15422 - ATP
| Formula | C10H16N5O13P3 |
| Net Charge | 0 |
| Average Mass | 507.182 |
| Monoisotopic Mass | 506.99575 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | ZKHQWZAMYRWXGA-KQYNXXCUSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). fundamental metabolite Any metabolite produced by all living cells. micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ATP (CHEBI:15422) has role cofactor (CHEBI:23357) |
| ATP (CHEBI:15422) has role fundamental metabolite (CHEBI:78675) |
| ATP (CHEBI:15422) has role micronutrient (CHEBI:27027) |
| ATP (CHEBI:15422) has role nutraceutical (CHEBI:50733) |
| ATP (CHEBI:15422) is a adenosine 5'-phosphate (CHEBI:37096) |
| ATP (CHEBI:15422) is a purine ribonucleoside 5'-triphosphate (CHEBI:37045) |
| ATP (CHEBI:15422) is conjugate acid of ATP(3−) (CHEBI:57299) |
| Incoming Relation(s) |
| N6-(dimethylallyl)adenosine 5'-triphosphate (CHEBI:71679) has functional parent ATP (CHEBI:15422) |
| 2-hydroxy-ATP (CHEBI:65119) has functional parent ATP (CHEBI:15422) |
| 3'-dehydro-ATP (CHEBI:27782) has functional parent ATP (CHEBI:15422) |
| 8-hydroxy-ATP (CHEBI:189101) has functional parent ATP (CHEBI:15422) |
| 8-oxo-ATP (CHEBI:189100) has functional parent ATP (CHEBI:15422) |
| 9-ribosyl-trans-zeatin 5'-triphosphate (CHEBI:71938) has functional parent ATP (CHEBI:15422) |
| adenosine 5'-[γ-thio]triphosphate (CHEBI:27575) has functional parent ATP (CHEBI:15422) |
| adenosine thiamine triphosphate (CHEBI:71394) has functional parent ATP (CHEBI:15422) |
| ATP-sugar (CHEBI:20855) has functional parent ATP (CHEBI:15422) |
| ethyl-ATP (CHEBI:62910) has functional parent ATP (CHEBI:15422) |
| TNP-ATP (CHEBI:50104) has functional parent ATP (CHEBI:15422) |
| adenosine triphosphate disodium (CHEBI:50732) has part ATP (CHEBI:15422) |
| ATP(3−) (CHEBI:57299) is conjugate base of ATP (CHEBI:15422) |
| IUPAC Name |
|---|
| adenosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| ATP | KEGG COMPOUND |
| Adenosine 5'-triphosphate | KEGG COMPOUND |
| Adenosine triphosphate | ChemIDplus |
| ADENOSINE-5'-TRIPHOSPHATE | PDBeChem |
| H4atp | IUPAC |
| Brand Names | Source |
|---|---|
| Adephos | DrugBank |
| Adetol | DrugBank |
| Adynol | DrugBank |
| Atipi | DrugBank |
| Atriphos | DrugBank |
| Cardenosine | DrugBank |