EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N8O19P3 |
| Net Charge | 0 |
| Average Mass | 718.271 |
| Monoisotopic Mass | 717.98228 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]2OC3(O[C@H]21)C([N+](=O)[O-])=CC([N+](=O)[O-])=CC3[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N8O19P3/c17-13-10-14(19-4-18-13)21(5-20-10)15-12-11(7(39-15)3-38-45(34,35)43-46(36,37)42-44(31,32)33)40-16(41-12)8(23(27)28)1-6(22(25)26)2-9(16)24(29)30/h1-2,4-5,7-8,11-12,15H,3H2,(H,34,35)(H,36,37)(H2,17,18,19)(H2,31,32,33)/t7-,8?,11-,12-,15-,16?/m1/s1 |
| InChIKey | DSFVPALDDWRTFF-DIBLVGDCSA-N |
| Roles Classification |
|---|
| Biological Role: | antagonist Substance that attaches to and blocks cell receptors that normally bind naturally occurring substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TNP-ATP (CHEBI:50104) has functional parent ({[(2R,3S,4R,5R)-3,4-dihydroxy-5-(9H-purin-9-yl)oxolan-2-yl]methyl phosphonato}oxy)(phosphonatooxy)phosphinate (CHEBI:237958) |
| TNP-ATP (CHEBI:50104) has functional parent ATP (CHEBI:15422) |
| TNP-ATP (CHEBI:50104) has functional parent picric acid (CHEBI:46149) |
| TNP-ATP (CHEBI:50104) has role antagonist (CHEBI:48706) |
| TNP-ATP (CHEBI:50104) is a C-nitro compound (CHEBI:35716) |
| TNP-ATP (CHEBI:50104) is a spiroketal (CHEBI:72600) |
| TNP-ATP (CHEBI:50104) is conjugate acid of TNP-ATP5− (CHEBI:50105) |
| Incoming Relation(s) |
| TNP-ATP5− (CHEBI:50105) is conjugate base of TNP-ATP (CHEBI:50104) |
| IUPAC Name |
|---|
| 2',3'-O-(2,4,6-trinitrocyclohexadiene-1,1-diyl)adenosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| 2',3'-O-(2,4,6-trinitro-cyclohexadienylidine)adenosine 5'-triphosphate | ChemIDplus |
| 2',3'-O-(2,4,6-trinitrophenyl)adenosine 5'-triphosphate | ChEBI |
| 2',3'-O-(2,4,6-trinitrophenyl)-ATP | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9747873 | Reaxys |
| Citations |
|---|