EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N5O13P3 |
| Net Charge | 0 |
| Average Mass | 575.301 |
| Monoisotopic Mass | 575.05835 |
| SMILES | CC(C)=CCNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H24N5O13P3/c1-8(2)3-4-16-13-10-14(18-6-17-13)20(7-19-10)15-12(22)11(21)9(31-15)5-30-35(26,27)33-36(28,29)32-34(23,24)25/h3,6-7,9,11-12,15,21-22H,4-5H2,1-2H3,(H,26,27)(H,28,29)(H,16,17,18)(H2,23,24,25)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | OPLVZTYVQUWKHB-SDBHATRESA-N |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-(dimethylallyl)adenosine 5'-triphosphate (CHEBI:71679) has functional parent ATP (CHEBI:15422) |
| N6-(dimethylallyl)adenosine 5'-triphosphate (CHEBI:71679) is a adenosine 5'-phosphate (CHEBI:37096) |
| N6-(dimethylallyl)adenosine 5'-triphosphate (CHEBI:71679) is a purine ribonucleoside 5'-triphosphate (CHEBI:37045) |
| N6-(dimethylallyl)adenosine 5'-triphosphate (CHEBI:71679) is conjugate acid of N6-(dimethylallyl)adenosine 5'-triphosphate(4−) (CHEBI:73532) |
| Incoming Relation(s) |
| N6-(dimethylallyl)adenosine 5'-triphosphate(4−) (CHEBI:73532) is conjugate base of N6-(dimethylallyl)adenosine 5'-triphosphate (CHEBI:71679) |
| IUPAC Name |
|---|
| N-(3-methylbut-2-en-1-yl)adenosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| N6-isopentenyladenosine 5'-triphosphate | ChEBI |
| N6-(Δ2-isopentenyl)adenosine 5'-triphosphate | ChEBI |
| Isopentenyladenosine-5'-triphosphate | KEGG COMPOUND |
| isopentenyladenosine riboside-5'-triphosphate | MetaCyc |
| Isopentenyl-ATP | KEGG COMPOUND |