EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O13P3 |
| Net Charge | -3 |
| Average Mass | 504.158 |
| Monoisotopic Mass | 503.97392 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/p-3/t4-,6-,7-,10-/m1/s1 |
| InChIKey | ZKHQWZAMYRWXGA-KQYNXXCUSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). fundamental metabolite Any metabolite produced by all living cells. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ATP(3−) (CHEBI:57299) has role cofactor (CHEBI:23357) |
| ATP(3−) (CHEBI:57299) has role fundamental metabolite (CHEBI:78675) |
| ATP(3−) (CHEBI:57299) has role human metabolite (CHEBI:77746) |
| ATP(3−) (CHEBI:57299) is a ribonucleoside triphosphate oxoanion (CHEBI:59724) |
| ATP(3−) (CHEBI:57299) is conjugate acid of ATP(4−) (CHEBI:30616) |
| ATP(3−) (CHEBI:57299) is conjugate base of ({[(2R,3S,4R,5R)-3,4-dihydroxy-5-(9H-purin-9-yl)oxolan-2-yl]methyl phosphonato}oxy)(phosphonatooxy)phosphinate (CHEBI:237958) |
| ATP(3−) (CHEBI:57299) is conjugate base of ATP (CHEBI:15422) |
| Incoming Relation(s) |
| ({[(2R,3S,4R,5R)-3,4-dihydroxy-5-(9H-purin-9-yl)oxolan-2-yl]methyl phosphonato}oxy)(phosphonatooxy)phosphinate (CHEBI:237958) is conjugate acid of ATP(3−) (CHEBI:57299) |
| ATP (CHEBI:15422) is conjugate acid of ATP(3−) (CHEBI:57299) |
| ATP(4−) (CHEBI:30616) is conjugate base of ATP(3−) (CHEBI:57299) |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9535056 | Beilstein |