EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31N9O13P3S |
| Net Charge | +1 |
| Average Mass | 754.529 |
| Monoisotopic Mass | 754.09694 |
| SMILES | Cc1ncc(C[n+]2csc(CCOP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)c2C)c(N)n1 |
| InChI | InChI=1S/C22H30N9O13P3S/c1-11-15(48-10-30(11)6-13-5-25-12(2)29-19(13)23)3-4-40-45(34,35)43-47(38,39)44-46(36,37)41-7-14-17(32)18(33)22(42-14)31-9-28-16-20(24)26-8-27-21(16)31/h5,8-10,14,17-18,22,32-33H,3-4,6-7H2,1-2H3,(H6-,23,24,25,26,27,29,34,35,36,37,38,39)/p+1/t14-,17-,18-,22-/m1/s1 |
| InChIKey | FGOYXNBJKMNPDH-SAJUPQAESA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adenosine thiamine triphosphate (CHEBI:71394) has functional parent ATP (CHEBI:15422) |
| adenosine thiamine triphosphate (CHEBI:71394) has functional parent thiamine(1+) (CHEBI:18385) |
| adenosine thiamine triphosphate (CHEBI:71394) is a adenosine 5'-phosphate (CHEBI:37096) |
| adenosine thiamine triphosphate (CHEBI:71394) is conjugate acid of adenosine thiamine triphosphate(2−) (CHEBI:71393) |
| Incoming Relation(s) |
| adenosine thiamine triphosphate(2−) (CHEBI:71393) is conjugate base of adenosine thiamine triphosphate (CHEBI:71394) |
| IUPAC Name |
|---|
| 5'-O-[{[{[(2-{3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl}ethoxy)(hydroxy)phosphoryl]oxy}(hydroxy)phosphoryl]oxy}(hydroxy)phosphoryl]adenosine |
| Synonyms | Source |
|---|---|
| AThTP | MetaCyc |
| ATP-thiamine | ChEBI |
| thiamine-ATP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1095 | MetaCyc |
| Citations |
|---|