EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N2O3S |
| Net Charge | 0 |
| Average Mass | 216.262 |
| Monoisotopic Mass | 216.05686 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2N |
| InChI | InChI=1S/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/t3-,4+,6-/m1/s1 |
| InChIKey | NGHVIOIJCVXTGV-ALEPSDHESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-aminopenicillanic acid (CHEBI:16705) has functional parent penicillanic acid (CHEBI:37806) |
| 6-aminopenicillanic acid (CHEBI:16705) has role allergen (CHEBI:50904) |
| 6-aminopenicillanic acid (CHEBI:16705) is a penicillanic acids (CHEBI:25865) |
| 6-aminopenicillanic acid (CHEBI:16705) is conjugate acid of 6-aminopenicillanate (CHEBI:30938) |
| 6-aminopenicillanic acid (CHEBI:16705) is tautomer of 6-aminopenicillanic acid zwitterion (CHEBI:57869) |
| Incoming Relation(s) |
| 6-aminopenicilloyl-butylamine (CHEBI:55475) has functional parent 6-aminopenicillanic acid (CHEBI:16705) |
| 6-formamidopenicillanic acid (CHEBI:59004) has functional parent 6-aminopenicillanic acid (CHEBI:16705) |
| penicillin (CHEBI:17334) has functional parent 6-aminopenicillanic acid (CHEBI:16705) |
| 6-aminopenicillanate (CHEBI:30938) is conjugate base of 6-aminopenicillanic acid (CHEBI:16705) |
| 6-aminopenicilloyl group (CHEBI:55441) is substituent group from 6-aminopenicillanic acid (CHEBI:16705) |
| 6-aminopenicillanic acid zwitterion (CHEBI:57869) is tautomer of 6-aminopenicillanic acid (CHEBI:16705) |
| IUPAC Name |
|---|
| 6-amino-2,2-dimethylpenam-3α-carboxylic acid |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| 6-Aminopenicillamine acid | ChemIDplus |
| 6-Aminopenicillanate | KEGG COMPOUND |
| (+)-6-aminopenicillanic acid | ChEBI |
| 6-Aminopenicillanic acid | KEGG COMPOUND |
| 6-Apa | ChemIDplus |
| Citations |
|---|