EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N2O3S |
| Net Charge | 0 |
| Average Mass | 216.262 |
| Monoisotopic Mass | 216.05686 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2[NH3+] |
| InChI | InChI=1S/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/t3-,4+,6-/m1/s1 |
| InChIKey | NGHVIOIJCVXTGV-ALEPSDHESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-aminopenicillanic acid zwitterion (CHEBI:57869) is a amino-acid zwitterion (CHEBI:35238) |
| 6-aminopenicillanic acid zwitterion (CHEBI:57869) is conjugate acid of 6-aminopenicillanate (CHEBI:30938) |
| 6-aminopenicillanic acid zwitterion (CHEBI:57869) is tautomer of 6-aminopenicillanic acid (CHEBI:16705) |
| Incoming Relation(s) |
| 6-aminopenicillanate (CHEBI:30938) is conjugate base of 6-aminopenicillanic acid zwitterion (CHEBI:57869) |
| 6-aminopenicillanic acid (CHEBI:16705) is tautomer of 6-aminopenicillanic acid zwitterion (CHEBI:57869) |
| IUPAC Name |
|---|
| 6-azaniumyl-2,2-dimethylpenam-3α-carboxylate |
| Synonym | Source |
|---|---|
| (2S,5R,6R)-6-azaniumyl-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | ChEBI |
| UniProt Name | Source |
|---|---|
| 6-aminopenicillanate | UniProt |