EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23N3O3S |
| Net Charge | 0 |
| Average Mass | 289.401 |
| Monoisotopic Mass | 289.14601 |
| SMILES | [H][C@@]1([C@H](N)C(=O)NCCCC)N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C12H23N3O3S/c1-4-5-6-14-9(16)7(13)10-15-8(11(17)18)12(2,3)19-10/h7-8,10,15H,4-6,13H2,1-3H3,(H,14,16)(H,17,18)/t7-,8+,10-/m1/s1 |
| InChIKey | FJEOKGAUBIDOBJ-KHQFGBGNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-aminopenicilloyl-butylamine (CHEBI:55475) has functional parent 6-aminopenicillanic acid (CHEBI:16705) |
| 6-aminopenicilloyl-butylamine (CHEBI:55475) is a monocarboxylic acid amide (CHEBI:29347) |
| 6-aminopenicilloyl-butylamine (CHEBI:55475) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| IUPAC Name |
|---|
| (2R,4S)-2-[(1R)-1-amino-2-(butylamino)-2-oxoethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| 6-aminopenicilloyl butylamine | ChEBI |
| 6APA-BA | ChEBI |
| 6APA-butylamine | ChEBI |
| Citations |
|---|