EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11N2O3S |
| Net Charge | -1 |
| Average Mass | 215.254 |
| Monoisotopic Mass | 215.04959 |
| SMILES | [H][C@]12SC(C)(C)[C@]([H])(C(=O)[O-])N1C(=O)[C@@]2([H])N |
| InChI | InChI=1S/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/p-1/t3-,4+,6-/m1/s1 |
| InChIKey | NGHVIOIJCVXTGV-ALEPSDHESA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-aminopenicillanate (CHEBI:30938) is a penicillinate anion (CHEBI:51356) |
| 6-aminopenicillanate (CHEBI:30938) is conjugate base of 6-aminopenicillanic acid (CHEBI:16705) |
| 6-aminopenicillanate (CHEBI:30938) is conjugate base of 6-aminopenicillanic acid zwitterion (CHEBI:57869) |
| Incoming Relation(s) |
| 6-aminopenicillanic acid (CHEBI:16705) is conjugate acid of 6-aminopenicillanate (CHEBI:30938) |
| 6-aminopenicillanic acid zwitterion (CHEBI:57869) is conjugate acid of 6-aminopenicillanate (CHEBI:30938) |
| IUPAC Name |
|---|
| (2S,5R,6R)-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| C02954 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Gmelin:604420 | Gmelin |