EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O4S |
| Net Charge | 0 |
| Average Mass | 244.272 |
| Monoisotopic Mass | 244.05178 |
| SMILES | [H]C(=O)N[C@@H]1C(=O)N2[C@@H](C(=O)O)C(C)(C)S[C@]12[H] |
| InChI | InChI=1S/C9H12N2O4S/c1-9(2)5(8(14)15)11-6(13)4(10-3-12)7(11)16-9/h3-5,7H,1-2H3,(H,10,12)(H,14,15)/t4-,5+,7-/m1/s1 |
| InChIKey | MDQGTDMBVJCTBN-JCGDXUMPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-formamidopenicillanic acid (CHEBI:59004) has functional parent 6-aminopenicillanic acid (CHEBI:16705) |
| 6-formamidopenicillanic acid (CHEBI:59004) is a penicillanic acids (CHEBI:25865) |
| 6-formamidopenicillanic acid (CHEBI:59004) is conjugate acid of 6-formamidopenicillanate (CHEBI:59005) |
| Incoming Relation(s) |
| 6-formamidopenicilloyl group (CHEBI:55480) has functional parent 6-formamidopenicillanic acid (CHEBI:59004) |
| 6-formamidopenicillanate (CHEBI:59005) is conjugate base of 6-formamidopenicillanic acid (CHEBI:59004) |
| IUPAC Name |
|---|
| 6-formamido-2,2-dimethylpenam-3α-carboxylic acid |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-6-formamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| 6-formamido-2,2-dimethylpenam-3α-carboxylic acid | ChemIDplus |
| 6β-formylaminopenicillanic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1218301 | Reaxys |
| CAS:64527-04-4 | ChemIDplus |
| Citations |
|---|