EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO3S |
| Net Charge | 0 |
| Average Mass | 201.247 |
| Monoisotopic Mass | 201.04596 |
| SMILES | [H][C@@]12CC(=O)N1[C@@H](C(=O)O)C(C)(C)S2 |
| InChI | InChI=1S/C8H11NO3S/c1-8(2)6(7(11)12)9-4(10)3-5(9)13-8/h5-6H,3H2,1-2H3,(H,11,12)/t5-,6+/m1/s1 |
| InChIKey | RBKMMJSQKNKNEV-RITPCOANSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penicillanic acid (CHEBI:37806) is a penicillanic acids (CHEBI:25865) |
| Incoming Relation(s) |
| (S)-2,5,5-trimethylthiazolidine-4-carboxylic acid (CHEBI:141059) has functional parent penicillanic acid (CHEBI:37806) |
| 6-aminopenicillanic acid (CHEBI:16705) has functional parent penicillanic acid (CHEBI:37806) |
| IUPAC Name |
|---|
| 2,2-dimethylpenam-3α-carboxylic acid |
| Synonyms | Source |
|---|---|
| (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| penicillanic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4677775 | Reaxys |
| CAS:87-53-6 | ChemIDplus |