EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O5 |
| Net Charge | 0 |
| Average Mass | 354.487 |
| Monoisotopic Mass | 354.24062 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | PXGPLTODNUVGFL-YNNPMVKQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | |||
| - | MetaboLights (MTBLS143) | ||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin F2α (CHEBI:15553) has role human metabolite (CHEBI:77746) |
| prostaglandin F2α (CHEBI:15553) has role mouse metabolite (CHEBI:75771) |
| prostaglandin F2α (CHEBI:15553) is a monocarboxylic acid (CHEBI:25384) |
| prostaglandin F2α (CHEBI:15553) is a prostaglandins Fα (CHEBI:36066) |
| prostaglandin F2α (CHEBI:15553) is conjugate acid of prostaglandin F2α(1−) (CHEBI:57404) |
| Incoming Relation(s) |
| 11-epi-prostaglandin F2α (CHEBI:27595) has functional parent prostaglandin F2α (CHEBI:15553) |
| 13,14-dihydro-15-keto-PGF2α (CHEBI:63976) has functional parent prostaglandin F2α (CHEBI:15553) |
| 13,14-dihydroprostaglandin F2α (CHEBI:88346) has functional parent prostaglandin F2α (CHEBI:15553) |
| 15-oxoprostaglandin F2α (CHEBI:28442) has functional parent prostaglandin F2α (CHEBI:15553) |
| 8-epi-prostaglandin F2α (CHEBI:34505) has functional parent prostaglandin F2α (CHEBI:15553) |
| carboprost (CHEBI:3403) has functional parent prostaglandin F2α (CHEBI:15553) |
| prostaglandin F2α 1-ethanolamide (CHEBI:53081) has functional parent prostaglandin F2α (CHEBI:15553) |
| prostaglandin F2α 1-glyceryl ester (CHEBI:90233) has functional parent prostaglandin F2α (CHEBI:15553) |
| prostaglandin F2α 2-glyceryl ester (CHEBI:137178) has functional parent prostaglandin F2α (CHEBI:15553) |
| prostaglandin F2α dimethylamine (CHEBI:73741) has functional parent prostaglandin F2α (CHEBI:15553) |
| tafluprost (CHEBI:66899) has functional parent prostaglandin F2α (CHEBI:15553) |
| 2,3-dinor-8-epi-prostaglandin F2α (CHEBI:34230) is a prostaglandin F2α (CHEBI:15553) |
| prostaglandin F2α(1−) (CHEBI:57404) is conjugate base of prostaglandin F2α (CHEBI:15553) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-9α,11α,15-trihydroxyprosta-5,13-dien-1-oic acid |
| INNs | Source |
|---|---|
| dinoprost | ChemIDplus |
| dinoprosta | ChemIDplus |
| dinoprostum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (5Z,13E)-(15S)-9alpha,11alpha,15-Trihydroxyprosta-5,13-dienoate | KEGG COMPOUND |
| 7-[3,5-Dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl]-5-heptenoic acid | KEGG COMPOUND |
| 9,11,15-Trihydroxy-(5Z,9a,11a,13E,15S)-prosta-5,13-dien-1-oic acid | KEGG COMPOUND |
| 9a,11a-PGF2 | KEGG COMPOUND |
| Amoglandin | KEGG COMPOUND |
| Cyclosin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1803 | VSDB |
| 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY | MetaCyc |
| 912 | DrugCentral |
| C00639 | KEGG COMPOUND |
| D00081 | KEGG DRUG |
| Dinoprost | Wikipedia |
| HMDB0001139 | HMDB |
| LMFA03010002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2225571 | Reaxys |
| CAS:551-11-1 | KEGG COMPOUND |
| CAS:551-11-1 | ChemIDplus |
| Citations |
|---|