EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O5 |
| Net Charge | 0 |
| Average Mass | 326.433 |
| Monoisotopic Mass | 326.20932 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H](C/C=C\CC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C18H30O5/c1-2-3-4-7-13(19)10-11-15-14(16(20)12-17(15)21)8-5-6-9-18(22)23/h5-6,10-11,13-17,19-21H,2-4,7-9,12H2,1H3,(H,22,23)/b6-5-,11-10+/t13-,14-,15+,16-,17+/m0/s1 |
| InChIKey | IDKLJIUIJUVJNR-JSEKUSAISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dinor-8-epi-prostaglandin F2α (CHEBI:34230) is a prostaglandin F2α (CHEBI:15553) |
| 2,3-dinor-8-epi-prostaglandin F2α (CHEBI:34230) is a prostanoid (CHEBI:26347) |
| IUPAC Names |
|---|
| (3Z)-5-{(1S,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl}pent-3-enoic acid |
| (5Z,13E,15S)-9α,11α,15-trihydroxy-2,3-dinor-8β-prosta-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| 2,3-Dinor-8-iso PGF2alpha | KEGG COMPOUND |
| 2,3-Dinor-8-iso prostaglandin F2alpha | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14794 | KEGG COMPOUND |
| LMFA03110010 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:221664-05-7 | KEGG COMPOUND |