EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H41NO3 |
| Net Charge | 0 |
| Average Mass | 367.574 |
| Monoisotopic Mass | 367.30864 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCCN(C)C)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H41NO3/c1-4-5-9-12-18(24)14-15-20-19(21(25)17-22(20)26)13-10-7-6-8-11-16-23(2)3/h7,10,14-15,18-22,24-26H,4-6,8-9,11-13,16-17H2,1-3H3/b10-7-,15-14+/t18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | VNLQPSLXSAMMMJ-PIOKUXGXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin F2α dimethylamine (CHEBI:73741) has functional parent dimethylamine (CHEBI:17170) |
| prostaglandin F2α dimethylamine (CHEBI:73741) has functional parent prostaglandin F2α (CHEBI:15553) |
| prostaglandin F2α dimethylamine (CHEBI:73741) has role metabolite (CHEBI:25212) |
| prostaglandin F2α dimethylamine (CHEBI:73741) is a prostaglandins Fα (CHEBI:36066) |
| prostaglandin F2α dimethylamine (CHEBI:73741) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| (5Z,9α,11α,13E,15S)-1-(dimethylamino)prosta-5,13-diene-9,11,15-triol |
| Synonyms | Source |
|---|---|
| PGF2α dimethylamine | ChEBI |
| N-Dimethylaminoprostaglandin F2α | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMFA03010114 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8730906 | Reaxys |
| CAS:67508-09-2 | ChemIDplus |
| Citations |
|---|