EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O5 |
| Net Charge | 0 |
| Average Mass | 354.487 |
| Monoisotopic Mass | 354.24062 |
| SMILES | CCCCCC(=O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,16-19,22-23H,2-3,5-6,8-14H2,1H3,(H,24,25)/b7-4-/t16-,17-,18+,19-/m1/s1 |
| InChIKey | VKTIONYPMSCHQI-XAGFEHLVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13,14-dihydro-15-keto-PGF2α (CHEBI:63976) has functional parent prostaglandin F2α (CHEBI:15553) |
| 13,14-dihydro-15-keto-PGF2α (CHEBI:63976) has role metabolite (CHEBI:25212) |
| 13,14-dihydro-15-keto-PGF2α (CHEBI:63976) is a ketone (CHEBI:17087) |
| 13,14-dihydro-15-keto-PGF2α (CHEBI:63976) is a prostaglandins Fα (CHEBI:36066) |
| 13,14-dihydro-15-keto-PGF2α (CHEBI:63976) is conjugate acid of 13,14-dihydro-15-keto-PGF2α(1−) (CHEBI:133374) |
| Incoming Relation(s) |
| 13,14-dihydro-15-keto PGF2α isopropyl ester (CHEBI:142507) has functional parent 13,14-dihydro-15-keto-PGF2α (CHEBI:63976) |
| 13,14-dihydro-15-keto-PGF2α(1−) (CHEBI:133374) is conjugate base of 13,14-dihydro-15-keto-PGF2α (CHEBI:63976) |
| IUPAC Name |
|---|
| (5Z,9α,11α)-9,11-dihydroxy-15-oxoprost-5-en-1-oic acid |
| Synonyms | Source |
|---|---|
| 13,14-Dihydro-15-keto-pgf2alpha | ChemIDplus |
| 13,14-dihydro-15-keto-Prostaglandin F2a | LIPID MAPS |
| 13,14-Dihydro-15-ketoprostaglandin F2alpha | ChemIDplus |
| 15-Keto-13,14-dihydro-pgf2alpha | ChemIDplus |
| 15-Keto-13,14-dihydroprostaglandin F2-alpha | ChemIDplus |
| 15-Keto-13,14-dihydroprostaglandin F2alpha | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0004685 | HMDB |
| LMFA03010027 | LIPID MAPS |
| US5397797 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6227023 | Reaxys |
| CAS:27376-76-7 | ChemIDplus |
| Citations |
|---|