EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34F2O5 |
| Net Charge | 0 |
| Average Mass | 452.538 |
| Monoisotopic Mass | 452.23743 |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/C(F)(F)COc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H34F2O5/c1-18(2)32-24(30)13-9-4-3-8-12-20-21(23(29)16-22(20)28)14-15-25(26,27)17-31-19-10-6-5-7-11-19/h3,5-8,10-11,14-15,18,20-23,28-29H,4,9,12-13,16-17H2,1-2H3/b8-3-,15-14+/t20-,21-,22+,23-/m1/s1 |
| InChIKey | WSNODXPBBALQOF-VEJSHDCNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | prostaglandin receptor agonist An agonist that binds to and activates prostaglandin receptors. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tafluprost (CHEBI:66899) has functional parent prostaglandin F2α (CHEBI:15553) |
| tafluprost (CHEBI:66899) has role antiglaucoma drug (CHEBI:39456) |
| tafluprost (CHEBI:66899) has role antihypertensive agent (CHEBI:35674) |
| tafluprost (CHEBI:66899) has role prostaglandin receptor agonist (CHEBI:66900) |
| tafluprost (CHEBI:66899) is a isopropyl ester (CHEBI:35725) |
| tafluprost (CHEBI:66899) is a organofluorine compound (CHEBI:37143) |
| tafluprost (CHEBI:66899) is a prostaglandins Fα (CHEBI:36066) |
| IUPAC Name |
|---|
| isopropyl (5Z)-7-{(1R,2R,3R,5S)-2-[(1E)-3,3-difluoro-4-phenoxybut-1-en-1-yl]-3,5-dihydroxycyclopentyl}hept-5-enoate |
| INN | Source |
|---|---|
| tafluprost | KEGG DRUG |
| Synonyms | Source |
|---|---|
| AFP-168 | ChEMBL |
| MK-2452 | ChEMBL |
| Brand Names | Source |
|---|---|
| Saflutan | ChEMBL |
| Zioptan | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4229 | DrugCentral |
| D06274 | KEGG DRUG |
| EP1825855 | Patent |
| Tafluprost | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9668502 | Reaxys |
| CAS:209860-87-7 | KEGG DRUG |
| CAS:209860-87-7 | ChemIDplus |
| Citations |
|---|