EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34F2O5 |
| Net Charge | 0 |
| Average Mass | 452.538 |
| Monoisotopic Mass | 452.23743 |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/C(F)(F)COc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H34F2O5/c1-18(2)32-24(30)13-9-4-3-8-12-20-21(23(29)16-22(20)28)14-15-25(26,27)17-31-19-10-6-5-7-11-19/h3,5-8,10-11,14-15,18,20-23,28-29H,4,9,12-13,16-17H2,1-2H3/b8-3-,15-14+/t20-,21-,22+,23-/m1/s1 |
| InChIKey | WSNODXPBBALQOF-VEJSHDCNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | prostaglandin receptor agonist An agonist that binds to and activates prostaglandin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tafluprost (CHEBI:66899) has functional parent prostaglandin F2α (CHEBI:15553) |
| tafluprost (CHEBI:66899) has role prostaglandin receptor agonist (CHEBI:66900) |
| tafluprost (CHEBI:66899) is a isopropyl ester (CHEBI:35725) |
| tafluprost (CHEBI:66899) is a organofluorine compound (CHEBI:37143) |
| tafluprost (CHEBI:66899) is a prostaglandins Fα (CHEBI:36066) |
| IUPAC Name |
|---|
| isopropyl (5Z)-7-{(1R,2R,3R,5S)-2-[(1E)-3,3-difluoro-4-phenoxybut-1-en-1-yl]-3,5-dihydroxycyclopentyl}hept-5-enoate |
| INN | Source |
|---|---|
| tafluprost | KEGG DRUG |
| Brand Name | Source |
|---|---|
| Zioptan | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4229 | DrugCentral |
| D06274 | KEGG DRUG |
| EP1825855 | Patent |
| Tafluprost | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9668502 | Reaxys |
| CAS:209860-87-7 | ChemIDplus |
| CAS:209860-87-7 | KEGG DRUG |
| Citations |
|---|