EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O5 |
| Net Charge | 0 |
| Average Mass | 356.503 |
| Monoisotopic Mass | 356.25627 |
| SMILES | CCCCC[C@H](O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H36O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,15-19,21-23H,2-3,5-6,8-14H2,1H3,(H,24,25)/b7-4-/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | LLQBSJQTCKVWTD-NFUXFLSFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS243) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (6572072) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13,14-dihydroprostaglandin F2α (CHEBI:88346) has functional parent prostaglandin F2α (CHEBI:15553) |
| 13,14-dihydroprostaglandin F2α (CHEBI:88346) has role rat metabolite (CHEBI:86264) |
| 13,14-dihydroprostaglandin F2α (CHEBI:88346) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 13,14-dihydroprostaglandin F2α (CHEBI:88346) is a prostaglandins Fα (CHEBI:36066) |
| 13,14-dihydroprostaglandin F2α (CHEBI:88346) is conjugate acid of 13,14-dihydroprostaglandin F2α(1−) (CHEBI:133376) |
| Incoming Relation(s) |
| 13,14-dihydroprostaglandin F2α(1−) (CHEBI:133376) is conjugate base of 13,14-dihydroprostaglandin F2α (CHEBI:88346) |
| IUPAC Name |
|---|
| (5Z,9α,11α,15S)-9,11,15-trihydroxyprost-5-en-1-oic acid |
| Synonyms | Source |
|---|---|
| 13,14-Dihydrodinoprost | HMDB |
| 13,14-dihydro-PGF2α | ChEBI |
| 13,14-Dihydroprostaglandin F2-alpha | ChemIDplus |
| 13,14-dihydro-prostaglandin F2α | LIPID MAPS |
| 9S,11R,15S-trihydroxy-5Z-prostenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| HMDB0004239 | HMDB |
| LMFA03010079 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2885169 | Reaxys |
| CAS:27376-74-5 | ChemIDplus |
| Citations |
|---|