EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36O5 |
| Net Charge | 0 |
| Average Mass | 368.514 |
| Monoisotopic Mass | 368.25627 |
| SMILES | CCCCC[C@](C)(O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C21H36O5/c1-3-4-9-13-21(2,26)14-12-17-16(18(22)15-19(17)23)10-7-5-6-8-11-20(24)25/h5,7,12,14,16-19,22-23,26H,3-4,6,8-11,13,15H2,1-2H3,(H,24,25)/b7-5-,14-12+/t16-,17-,18+,19-,21+/m1/s1 |
| InChIKey | DLJKPYFALUEJCK-IIELGFQLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | abortifacient A chemical substance that interrupts pregnancy after implantation. oxytocic A drug that stimulates contraction of the myometrium. Oxytocics are used to induce labour, obstetric at term, to prevent or control postpartum or postabortion haemorrhage, and to assess foetal status in high risk pregnancies. They may also be used alone or with other drugs to induce abortions (abortifacients). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carboprost (CHEBI:3403) has functional parent prostaglandin F2α (CHEBI:15553) |
| carboprost (CHEBI:3403) has role abortifacient (CHEBI:50691) |
| carboprost (CHEBI:3403) has role oxytocic (CHEBI:36063) |
| carboprost (CHEBI:3403) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| carboprost (CHEBI:3403) is conjugate acid of carboprost(1−) (CHEBI:59205) |
| Incoming Relation(s) |
| carboprost(1−) (CHEBI:59205) is conjugate base of carboprost (CHEBI:3403) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-9α,11α,15-trihydroxy-15-methylprosta-5,13-dien-1-oic acid |
| INNs | Source |
|---|---|
| carboprost | WHO MedNet |
| carboprost | WHO MedNet |
| carboprostum | WHO MedNet |
| carboprost | WHO MedNet |
| Synonyms | Source |
|---|---|
| (15S)-15-methyl-PGF2α | ChemIDplus |
| (15S)-15-methylprostaglandin F2α | ChemIDplus |
| 15(S)-15-methyl-PGF2α | ChemIDplus |
| 15(S)-15-methylprostaglandin F2α | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2949991 | Beilstein |
| CAS:35700-23-3 | KEGG COMPOUND |
| CAS:35700-23-3 | ChemIDplus |
| Citations |
|---|