EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O8 |
| Net Charge | 0 |
| Average Mass | 318.237 |
| Monoisotopic Mass | 318.03757 |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)c(O)c(O)c12 |
| InChI | InChI=1S/C15H10O8/c16-6-2-1-5(3-7(6)17)15-14(22)13(21)10-9(23-15)4-8(18)11(19)12(10)20/h1-4,16-20,22H |
| InChIKey | ZVOLCUVKHLEPEV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quercetagetin (CHEBI:8695) has functional parent quercetin (CHEBI:16243) |
| quercetagetin (CHEBI:8695) has role antioxidant (CHEBI:22586) |
| quercetagetin (CHEBI:8695) has role antiviral agent (CHEBI:22587) |
| quercetagetin (CHEBI:8695) has role plant metabolite (CHEBI:76924) |
| quercetagetin (CHEBI:8695) is a flavonols (CHEBI:28802) |
| quercetagetin (CHEBI:8695) is a hexahydroxyflavone (CHEBI:24561) |
| Incoming Relation(s) |
| 3',4',5-trihydroxy-3,6,7-trimethoxyflavone (CHEBI:18016) has functional parent quercetagetin (CHEBI:8695) |
| 3',4',5,6-tetrahydroxy-3,7-dimethoxyflavone (CHEBI:27767) has functional parent quercetagetin (CHEBI:8695) |
| axillarin (CHEBI:2941) has functional parent quercetagetin (CHEBI:8695) |
| casticin (CHEBI:69355) has functional parent quercetagetin (CHEBI:8695) |
| chrysosplenetin (CHEBI:3689) has functional parent quercetagetin (CHEBI:8695) |
| chrysosplenol C (CHEBI:3690) has functional parent quercetagetin (CHEBI:8695) |
| eupatin (CHEBI:75162) has functional parent quercetagetin (CHEBI:8695) |
| patuletin (CHEBI:75164) has functional parent quercetagetin (CHEBI:8695) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-3,5,6,7-tetrahydroxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Quercetagetin | KEGG COMPOUND |
| 6-Hydroxyquercetin | KEGG COMPOUND |
| 2-(3,4-dihydroxyphenyl)-3,5,6,7-tetrahydroxy-4-benzopyrone | ChemIDplus |
| 3,3',4',5,6,7-hexahydroxyflavone | ChEBI |
| 3,5,6,7,3',4'-hexahydroxyflavone | ChemIDplus |
| 2-(3,4-dihydroxyphenyl)-3,5,6,7-tetrahydroxy-4H-1-benzopyran-4-one | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C10122 | KEGG COMPOUND |
| KR20120035741 | Patent |
| LMPK12112983 | LIPID MAPS |
| Quercetagetin | Wikipedia |
| C00004677 | KNApSAcK |
| MYU | PDBeChem |
| FDB011897 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:332041 | Reaxys |
| CAS:90-18-6 | KEGG COMPOUND |
| CAS:90-18-6 | ChemIDplus |
| Citations |
|---|