EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O8 |
| Net Charge | 0 |
| Average Mass | 360.318 |
| Monoisotopic Mass | 360.08452 |
| SMILES | COc1cc2oc(-c3ccc(O)c(O)c3)c(OC)c(=O)c2c(O)c1OC |
| InChI | InChI=1S/C18H16O8/c1-23-12-7-11-13(14(21)17(12)24-2)15(22)18(25-3)16(26-11)8-4-5-9(19)10(20)6-8/h4-7,19-21H,1-3H3 |
| InChIKey | BYWLLSQTJBXAPV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',4',5-trihydroxy-3,6,7-trimethoxyflavone (CHEBI:18016) has functional parent quercetagetin (CHEBI:8695) |
| 3',4',5-trihydroxy-3,6,7-trimethoxyflavone (CHEBI:18016) has role antineoplastic agent (CHEBI:35610) |
| 3',4',5-trihydroxy-3,6,7-trimethoxyflavone (CHEBI:18016) has role metabolite (CHEBI:25212) |
| 3',4',5-trihydroxy-3,6,7-trimethoxyflavone (CHEBI:18016) is a trihydroxyflavone (CHEBI:27116) |
| 3',4',5-trihydroxy-3,6,7-trimethoxyflavone (CHEBI:18016) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',4',5-Trihydroxy-3,6,7-trimethoxyflavone | KEGG COMPOUND |
| Chrysosplenol D | KEGG COMPOUND |
| quercetagetin 3,6,7-trimethyl ether | ChEBI |
| UniProt Name | Source |
|---|---|
| 3',4',5-trihydroxy-3,6,7-trimethoxyflavone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00004692 | KNApSAcK |
| C04552 | KEGG COMPOUND |
| C04552 | KEGG COMPOUND |
| LMPK12112998 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:350587 | Reaxys |
| Citations |
|---|