EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O8 |
| Net Charge | 0 |
| Average Mass | 374.345 |
| Monoisotopic Mass | 374.10017 |
| SMILES | COc1ccc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2OC)cc1O |
| InChI | InChI=1S/C19H18O8/c1-23-11-6-5-9(7-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3 |
| InChIKey | PJQLSMYMOKWUJG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eremophila mitchellii (IPNI:585196-1) | leaf (BTO:0000713) | PubMed (21877688) | n-Hexane,Methylene dichloride and methanolic extarct of airdried and ground leaves |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| casticin (CHEBI:69355) has functional parent quercetagetin (CHEBI:8695) |
| casticin (CHEBI:69355) has role apoptosis inducer (CHEBI:68495) |
| casticin (CHEBI:69355) has role plant metabolite (CHEBI:76924) |
| casticin (CHEBI:69355) is a dihydroxyflavone (CHEBI:38686) |
| casticin (CHEBI:69355) is a tetramethoxyflavone (CHEBI:76875) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,6,7-trimethoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',5-dihydroxy-3,4',6,7-tetramethoxyflavone | ChemIDplus |
| 3,6,7,4'-tetra-O-methyl-5,3'-dihydroxyflavone | LIPID MAPS |
| 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one | ChemIDplus |
| quercetagetin 3,6,7,4'-tetramethyl ether | LIPID MAPS |
| vitexicarpin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Casticin | Wikipedia |
| CN101028261 | Patent |
| CN102743373 | Patent |
| HMDB0030660 | HMDB |
| LMPK12113010 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1300392 | Reaxys |
| CAS:479-91-4 | ChemIDplus |
| Citations |
|---|