EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O8 |
| Net Charge | 0 |
| Average Mass | 346.291 |
| Monoisotopic Mass | 346.06887 |
| SMILES | COc1c(O)cc2oc(-c3ccc(O)c(O)c3)c(OC)c(=O)c2c1O |
| InChI | InChI=1S/C17H14O8/c1-23-16-10(20)6-11-12(13(16)21)14(22)17(24-2)15(25-11)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
| InChIKey | KIGVXRGRNLQNNI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia chinensis (ncbitaxon:99046) | - | PubMed (24689280) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| axillarin (CHEBI:2941) has functional parent quercetagetin (CHEBI:8695) |
| axillarin (CHEBI:2941) has role plant metabolite (CHEBI:76924) |
| axillarin (CHEBI:2941) is a dimethoxyflavone (CHEBI:23798) |
| axillarin (CHEBI:2941) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 3',4',5,7-Tetrahydroxy-3,6-dimethoxyflavone | ChemIDplus |
| 3,6-Dimethoxyquercetagetin | ChemIDplus |
| Quercetagetin 3,6-dimethyl ether | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| Axillarin | Wikipedia |
| C00004684 | KNApSAcK |
| C10021 | KEGG COMPOUND |
| LMPK12112990 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1269336 | Reaxys |
| CAS:5188-73-8 | ChemIDplus |
| CAS:5188-73-8 | KEGG COMPOUND |
| Citations |
|---|