EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O8 |
| Net Charge | 0 |
| Average Mass | 374.345 |
| Monoisotopic Mass | 374.10017 |
| SMILES | COc1cc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2OC)ccc1O |
| InChI | InChI=1S/C19H18O8/c1-23-11-7-9(5-6-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3 |
| InChIKey | NBVTYGIYKCPHQN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laggera pterodonta (ncbitaxon:313968) | - | PubMed (20506820) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysosplenetin (CHEBI:3689) has functional parent quercetagetin (CHEBI:8695) |
| chrysosplenetin (CHEBI:3689) has role antiviral agent (CHEBI:22587) |
| chrysosplenetin (CHEBI:3689) has role plant metabolite (CHEBI:76924) |
| chrysosplenetin (CHEBI:3689) is a dihydroxyflavone (CHEBI:38686) |
| chrysosplenetin (CHEBI:3689) is a tetramethoxyflavone (CHEBI:76875) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| Chrysosplenetin B | KEGG COMPOUND |
| Quercetagetin 3,6,7,3'-tetramethyl ether | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00004704 | KNApSAcK |
| C10030 | KEGG COMPOUND |
| Chrysosplenetin | Wikipedia |
| LMPK12113009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:354967 | Reaxys |
| CAS:603-56-5 | ChemIDplus |
| CAS:603-56-5 | KEGG COMPOUND |
| Citations |
|---|