EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O8 |
| Net Charge | 0 |
| Average Mass | 360.318 |
| Monoisotopic Mass | 360.08452 |
| SMILES | COc1cc(-c2oc3cc(OC)c(O)c(O)c3c(=O)c2OC)ccc1O |
| InChI | InChI=1S/C18H16O8/c1-23-10-6-8(4-5-9(10)19)17-18(25-3)16(22)13-11(26-17)7-12(24-2)14(20)15(13)21/h4-7,19-21H,1-3H3 |
| InChIKey | QQBSPLCHDUCBNM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula aschersoniana (ncbitaxon:557639) | aerial part (BTO:0001658) | PubMed (25233586) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysosplenol C (CHEBI:3690) has functional parent quercetagetin (CHEBI:8695) |
| chrysosplenol C (CHEBI:3690) has role antineoplastic agent (CHEBI:35610) |
| chrysosplenol C (CHEBI:3690) has role antiviral agent (CHEBI:22587) |
| chrysosplenol C (CHEBI:3690) has role plant metabolite (CHEBI:76924) |
| chrysosplenol C (CHEBI:3690) is a trihydroxyflavone (CHEBI:27116) |
| chrysosplenol C (CHEBI:3690) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5,6-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| Quercetagetin 3,7,3'-trimethyl ether | KEGG COMPOUND |
| 4',5,6-trihydroxy-3,3',7-trimethoxyflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10031 | KEGG COMPOUND |
| C00001031 | KNApSAcK |
| LMPK12112982 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1441253 | Reaxys |
| CAS:23370-16-3 | KEGG COMPOUND |
| CAS:23370-16-3 | ChemIDplus |
| Citations |
|---|