EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O3 |
| Net Charge | 0 |
| Average Mass | 154.165 |
| Monoisotopic Mass | 154.06299 |
| SMILES | OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H10O3/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,9-11H,3-4H2 |
| InChIKey | JUUBCHWRXWPFFH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Olea europaea (ncbitaxon:4146) | |||
| fruit (BTO:0000486) | PubMed (22014120) | ||
| leaf (BTO:0000713) | PubMed (22014120) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxytyrosol (CHEBI:68889) has functional parent 2-(4-hydroxyphenyl)ethanol (CHEBI:1879) |
| hydroxytyrosol (CHEBI:68889) has role antineoplastic agent (CHEBI:35610) |
| hydroxytyrosol (CHEBI:68889) has role antioxidant (CHEBI:22586) |
| hydroxytyrosol (CHEBI:68889) has role metabolite (CHEBI:25212) |
| hydroxytyrosol (CHEBI:68889) is a catechols (CHEBI:33566) |
| hydroxytyrosol (CHEBI:68889) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| 2-(3,4-dihydroxyphenyl)-ethyl-O-β-D-glucopyranoside (CHEBI:65791) has functional parent hydroxytyrosol (CHEBI:68889) |
| acteoside (CHEBI:132853) has functional parent hydroxytyrosol (CHEBI:68889) |
| oleuropein (dialdehyde form) (CHEBI:68988) has functional parent hydroxytyrosol (CHEBI:68889) |
| scroside D (CHEBI:66442) has functional parent hydroxytyrosol (CHEBI:68889) |
| IUPAC Name |
|---|
| 4-(2-hydroxyethyl)benzene-1,2-diol |
| Synonyms | Source |
|---|---|
| 3,4-dihydroxyphenylethanol | ChemIDplus |
| dopet | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Hydroxytyrosol | Wikipedia |
| LSM-36968 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2208118 | Reaxys |
| CAS:10597-60-1 | ChemIDplus |
| Citations |
|---|