EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:1879 - 2-(4-hydroxyphenyl)ethanol
| Formula | C8H10O2 |
| Net Charge | 0 |
| Average Mass | 138.166 |
| Monoisotopic Mass | 138.06808 |
| SMILES | OCCc1ccc(O)cc1 |
| InChI | InChI=1S/C8H10O2/c9-6-5-7-1-3-8(10)4-2-7/h1-4,9-10H,5-6H2 |
| InChIKey | YCCILVSKPBXVIP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chrysogenum (ncbitaxon:5076) | mycelium (BTO:0001436) | PubMed (21381678) | Fungus isolated from the root surface of Rhizophora stylosa, EtOAc extract of fermentation broth Strain: PXP 55 |
| Stachylidium (ncbitaxon:796327) | - | PubMed (21162532) | Marine derived fungus isolated from sponge Callyspongia sp. cf. C. flammea Strain: 220 |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(4-hydroxyphenyl)ethanol (CHEBI:1879) has functional parent 2-phenylethanol (CHEBI:49000) |
| 2-(4-hydroxyphenyl)ethanol (CHEBI:1879) has role anti-arrhythmia drug (CHEBI:38070) |
| 2-(4-hydroxyphenyl)ethanol (CHEBI:1879) has role antioxidant (CHEBI:22586) |
| 2-(4-hydroxyphenyl)ethanol (CHEBI:1879) has role cardiovascular drug (CHEBI:35554) |
| 2-(4-hydroxyphenyl)ethanol (CHEBI:1879) has role fungal metabolite (CHEBI:76946) |
| 2-(4-hydroxyphenyl)ethanol (CHEBI:1879) has role geroprotector (CHEBI:176497) |
| 2-(4-hydroxyphenyl)ethanol (CHEBI:1879) has role plant metabolite (CHEBI:76924) |
| 2-(4-hydroxyphenyl)ethanol (CHEBI:1879) has role protective agent (CHEBI:50267) |
| 2-(4-hydroxyphenyl)ethanol (CHEBI:1879) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| crosatoside B (CHEBI:134473) has functional parent 2-(4-hydroxyphenyl)ethanol (CHEBI:1879) |
| hydroxytyrosol (CHEBI:68889) has functional parent 2-(4-hydroxyphenyl)ethanol (CHEBI:1879) |
| oleocanthal (CHEBI:85673) has functional parent 2-(4-hydroxyphenyl)ethanol (CHEBI:1879) |
| IUPAC Name |
|---|
| 4-(2-hydroxyethyl)phenol |
| Synonyms | Source |
|---|---|
| 4-Hydroxybenzeneethanol | ChemIDplus |
| 4-Hydroxyphenylethanol | KEGG COMPOUND |
| p-Hydroxyphenethyl alcohol | ChemIDplus |
| tyrosol | ChEBI |
| Tyrosol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 4-tyrosol | UniProt |
| Citations |
|---|