EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O6 |
| Net Charge | 0 |
| Average Mass | 320.341 |
| Monoisotopic Mass | 320.12599 |
| SMILES | C/C=C(/C=O)C(CC=O)CC(=O)OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H20O6/c1-2-13(11-19)14(5-7-18)10-17(22)23-8-6-12-3-4-15(20)16(21)9-12/h2-4,7,9,11,14,20-21H,5-6,8,10H2,1H3/b13-2- |
| InChIKey | XLPXUPOZUYGVPD-SILLCRNTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Olea europaea (ncbitaxon:4146) | leaf (BTO:0000713) | PubMed (22014168) | Methanolic and aqueous extract of dried olive leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oleuropein (dialdehyde form) (CHEBI:68988) has functional parent hydroxytyrosol (CHEBI:68889) |
| oleuropein (dialdehyde form) (CHEBI:68988) has role plant metabolite (CHEBI:76924) |
| oleuropein (dialdehyde form) (CHEBI:68988) is a carboxylic ester (CHEBI:33308) |
| oleuropein (dialdehyde form) (CHEBI:68988) is a catechols (CHEBI:33566) |
| oleuropein (dialdehyde form) (CHEBI:68988) is a dialdehyde (CHEBI:38124) |
| oleuropein (dialdehyde form) (CHEBI:68988) is a enal (CHEBI:51688) |
| Synonym | Source |
|---|---|
| 2-(3,4-Dihydroxyphenyl)ethyl (4E)-4-formyl-3-(2-oxoethyl)-4-hexenoate | ChEBI |
| Citations |
|---|