EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O8 |
| Net Charge | 0 |
| Average Mass | 316.306 |
| Monoisotopic Mass | 316.11582 |
| SMILES | OC[C@H]1O[C@@H](OCCc2ccc(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H20O8/c15-6-10-11(18)12(19)13(20)14(22-10)21-4-3-7-1-2-8(16)9(17)5-7/h1-2,5,10-20H,3-4,6H2/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | PQQITYGQJLPDFC-RKQHYHRCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Picrorhiza scrophulariiflora (ncbitaxon:470706) | root (BTO:0001188) | PubMed (15706916) | |
| Zantedeschia aethiopica (ncbitaxon:69721) | - | DOI (10.1016/S0031-9422(98)00092-2) | |
| Lepisorus contortus (ncbitaxon:699669) | whole plant (BTO:0001461) | PubMed (21261296) | 95% EtOH extract of air-dried, powdered whole plant |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(3,4-dihydroxyphenyl)-ethyl-O-β-D-glucopyranoside (CHEBI:65791) has functional parent hydroxytyrosol (CHEBI:68889) |
| 2-(3,4-dihydroxyphenyl)-ethyl-O-β-D-glucopyranoside (CHEBI:65791) has role antioxidant (CHEBI:22586) |
| 2-(3,4-dihydroxyphenyl)-ethyl-O-β-D-glucopyranoside (CHEBI:65791) has role metabolite (CHEBI:25212) |
| 2-(3,4-dihydroxyphenyl)-ethyl-O-β-D-glucopyranoside (CHEBI:65791) is a catechols (CHEBI:33566) |
| 2-(3,4-dihydroxyphenyl)-ethyl-O-β-D-glucopyranoside (CHEBI:65791) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)ethyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| dopaol β-D-glucoside | ChEBI |
| hydroxytyrosol glucoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5876669 | Reaxys |
| Citations |
|---|