EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O13 |
| Net Charge | 0 |
| Average Mass | 478.447 |
| Monoisotopic Mass | 478.16864 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@H](OCCc3ccc(O)c(O)c3)O[C@H](CO)[C@H]2O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H30O13/c21-6-11-13(25)15(27)16(28)20(32-11)33-18-14(26)12(7-22)31-19(17(18)29)30-4-3-8-1-2-9(23)10(24)5-8/h1-2,5,11-29H,3-4,6-7H2/t11-,12-,13-,14-,15+,16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | FKUWQWJFTAWUKB-KOIGGHRSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Picrorhiza scrophulariiflora (ncbitaxon:470706) | root (BTO:0001188) | PubMed (15133218) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scroside D (CHEBI:66442) has functional parent hydroxytyrosol (CHEBI:68889) |
| scroside D (CHEBI:66442) has role antioxidant (CHEBI:22586) |
| scroside D (CHEBI:66442) has role metabolite (CHEBI:25212) |
| scroside D (CHEBI:66442) is a catechols (CHEBI:33566) |
| scroside D (CHEBI:66442) is a disaccharide derivative (CHEBI:63353) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)ethyl 3-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9825849 | Reaxys |
| Citations |
|---|