EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H36O15 |
| Net Charge | 0 |
| Average Mass | 624.592 |
| Monoisotopic Mass | 624.20542 |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](OCCc3ccc(O)c(O)c3)O[C@H](CO)[C@H]2OC(=O)/C=C/c2ccc(O)c(O)c2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C29H36O15/c1-13-22(36)23(37)24(38)29(41-13)44-27-25(39)28(40-9-8-15-3-6-17(32)19(34)11-15)42-20(12-30)26(27)43-21(35)7-4-14-2-5-16(31)18(33)10-14/h2-7,10-11,13,20,22-34,36-39H,8-9,12H2,1H3/b7-4+/t13-,20+,22-,23+,24+,25+,26+,27+,28+,29-/m0/s1 |
| InChIKey | FBSKJMQYURKNSU-ZLSOWSIRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cistanche deserticola (ncbitaxon:161395) | - | PubMed (25900014) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acteoside (CHEBI:132853) has functional parent trans-caffeic acid (CHEBI:16433) |
| acteoside (CHEBI:132853) has functional parent hydroxytyrosol (CHEBI:68889) |
| acteoside (CHEBI:132853) has role anti-inflammatory agent (CHEBI:67079) |
| acteoside (CHEBI:132853) has role antibacterial agent (CHEBI:33282) |
| acteoside (CHEBI:132853) has role antileishmanial agent (CHEBI:70868) |
| acteoside (CHEBI:132853) has role neuroprotective agent (CHEBI:63726) |
| acteoside (CHEBI:132853) has role plant metabolite (CHEBI:76924) |
| acteoside (CHEBI:132853) is a catechols (CHEBI:33566) |
| acteoside (CHEBI:132853) is a cinnamate ester (CHEBI:36087) |
| acteoside (CHEBI:132853) is a disaccharide derivative (CHEBI:63353) |
| acteoside (CHEBI:132853) is a glycoside (CHEBI:24400) |
| acteoside (CHEBI:132853) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)ethyl 3-O-(6-deoxy-α-L-mannopyranosyl)-4-O-[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| verbascoside | ChemIDplus |
| kusaginin | ChemIDplus |
| 2-(3,4-dihydroxyphenyl)ethyl 3-O-(α-L-rhamnopyranosyl)-4-O-[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-β-D-glucopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10501 | KEGG COMPOUND |
| C00002783 | KNApSAcK |
| HMDB0034843 | HMDB |
| Verbascoside | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1278646 | Reaxys |
| CAS:61276-17-3 | KEGG COMPOUND |
| CAS:61276-17-3 | ChemIDplus |
| Citations |
|---|