EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O5 |
| Net Charge | 0 |
| Average Mass | 404.547 |
| Monoisotopic Mass | 404.25627 |
| SMILES | [H][C@@]12C(=C[C@H](C)C[C@@H]1OC(=O)[C@@H](C)CC)C=C[C@H](C)[C@@H]2CC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C24H36O5/c1-5-15(3)24(27)29-21-11-14(2)10-17-7-6-16(4)20(23(17)21)9-8-19-12-18(25)13-22(26)28-19/h6-7,10,14-16,18-21,23,25H,5,8-9,11-13H2,1-4H3/t14-,15-,16-,18+,19+,20-,21-,23-/m0/s1 |
| InChIKey | PCZOHLXUXFIOCF-BXMDZJJMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anticholesteremic drug A substance used to lower plasma cholesterol levels. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. anticholesteremic drug A substance used to lower plasma cholesterol levels. anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lovastatin (CHEBI:40303) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| lovastatin (CHEBI:40303) has functional parent mevastatin (CHEBI:34848) |
| lovastatin (CHEBI:40303) has role Aspergillus metabolite (CHEBI:76956) |
| lovastatin (CHEBI:40303) has role anticholesteremic drug (CHEBI:35821) |
| lovastatin (CHEBI:40303) has role antineoplastic agent (CHEBI:35610) |
| lovastatin (CHEBI:40303) has role prodrug (CHEBI:50266) |
| lovastatin (CHEBI:40303) is a fatty acid ester (CHEBI:35748) |
| lovastatin (CHEBI:40303) is a hexahydronaphthalenes (CHEBI:142348) |
| lovastatin (CHEBI:40303) is a polyketide (CHEBI:26188) |
| lovastatin (CHEBI:40303) is a statin (naturally occurring) (CHEBI:87632) |
| lovastatin (CHEBI:40303) is a δ-lactone (CHEBI:18946) |
| Incoming Relation(s) |
| mevinolinic acid (CHEBI:82985) has functional parent lovastatin (CHEBI:40303) |
| simvastatin (CHEBI:9150) has functional parent lovastatin (CHEBI:40303) |
| xuezhikang (CHEBI:231891) has part lovastatin (CHEBI:40303) |
| IUPAC Name |
|---|
| (1S,3R,7S,8S,8aR)-8-{2-[(2R,4R)-4-hydroxy-6-oxotetrahydro-2H-pyran-2-yl]ethyl}-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl (2S)-2-methylbutanoate |
| Synonyms | Source |
|---|---|
| (1S,3R,7S,8S,8aR)-1,2,3,7,8,8a-hexahydro-3,7-dimethyl-8-(2-(2R,4R)-(tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl)ethyl)-1-naphthalenyl (S)-2-methyl-butyrate | ChemIDplus |
| 2β,6α-dimethyl-8alpha-(2-methyl-1-oxobutoxy)-mevinic acid lactone | ChemIDplus |
| 6α-methylcompactin | ChemIDplus |
| Lovastatin | KEGG COMPOUND |
| LOVASTATIN | PDBeChem |
| Mevinolin | ChemIDplus |
| Brand Name | Source |
|---|---|
| Mevacor | ChemIDplus |
| UniProt Name | Source |
|---|---|
| lovastatin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1612 | DrugCentral |
| 803 | PDBeChem |
| C00000547 | KNApSAcK |
| C07074 | KEGG COMPOUND |
| CN103172602 | Patent |
| D00359 | KEGG DRUG |
| DB00227 | DrugBank |
| HMDB0014372 | HMDB |
| Lovastatin | Wikipedia |
| LSM-2189 | LINCS |
| WO2013090461 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3631989 | Beilstein |
| Reaxys:4720754 | Reaxys |
| CAS:75330-75-5 | KEGG DRUG |
| CAS:75330-75-5 | ChemIDplus |
| Citations |
|---|