EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O5 |
| Net Charge | 0 |
| Average Mass | 418.574 |
| Monoisotopic Mass | 418.27192 |
| SMILES | [H][C@@]12C(=C[C@H](C)C[C@@H]1OC(=O)C(C)(C)CC)C=C[C@H](C)[C@@H]2CC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C25H38O5/c1-6-25(4,5)24(28)30-21-12-15(2)11-17-8-7-16(3)20(23(17)21)10-9-19-13-18(26)14-22(27)29-19/h7-8,11,15-16,18-21,23,26H,6,9-10,12-14H2,1-5H3/t15-,16-,18+,19+,20-,21-,23-/m0/s1 |
| InChIKey | RYMZZMVNJRMUDD-HGQWONQESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor An EC 3.4.24.* (metalloendopeptidase) inhibitor that interferes with the action of anthrax lethal factor endopeptidase (EC 3.4.24.83). EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| simvastatin (CHEBI:9150) has functional parent lovastatin (CHEBI:40303) |
| simvastatin (CHEBI:9150) has role EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor (CHEBI:35664) |
| simvastatin (CHEBI:9150) has role EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor (CHEBI:77255) |
| simvastatin (CHEBI:9150) has role ferroptosis inducer (CHEBI:173085) |
| simvastatin (CHEBI:9150) has role geroprotector (CHEBI:176497) |
| simvastatin (CHEBI:9150) has role prodrug (CHEBI:50266) |
| simvastatin (CHEBI:9150) is a fatty acid ester (CHEBI:35748) |
| simvastatin (CHEBI:9150) is a hexahydronaphthalenes (CHEBI:142348) |
| simvastatin (CHEBI:9150) is a statin (semi-synthetic) (CHEBI:87633) |
| simvastatin (CHEBI:9150) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1S,3R,7S,8S,8aR)-8-{2-[(2R,4R)-4-hydroxy-6-oxotetrahydro-2H-pyran-2-yl]ethyl}-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl 2,2-dimethylbutanoate |
| INN | Source |
|---|---|
| simvastatin | DrugBank |
| Synonyms | Source |
|---|---|
| 2,2-dimethylbutyric acid, 8-ester with (4R,6R)-6-(2-((1S,2S,6R,8S,8aR)-1,2,6,7,8,8a-hexahydro-8-hydroxy-2,6-dimethyl-1-naphthyl)ethyl)tetrahydro-4-hydroxy-2H-pyran-2-one | ChemIDplus |
| MK-733 | KEGG DRUG |
| Simvastatin | KEGG DRUG |
| Simvastatina | ChemIDplus |
| Simvastatine | ChemIDplus |
| Simvastatinum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2445 | DrugCentral |
| D00434 | KEGG DRUG |
| DB00641 | DrugBank |
| EP33538 | Patent |
| HMDB0005007 | HMDB |
| LSM-2492 | LINCS |
| Simvastatin | Wikipedia |
| US4444784 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4768037 | Beilstein |
| CAS:79902-63-9 | ChemIDplus |
| CAS:79902-63-9 | KEGG DRUG |
| Citations |
|---|