EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O5 |
| Net Charge | 0 |
| Average Mass | 418.574 |
| Monoisotopic Mass | 418.27192 |
| SMILES | [H][C@@]12C(=C[C@H](C)C[C@@H]1OC(=O)C(C)(C)CC)C=C[C@H](C)[C@@H]2CC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C25H38O5/c1-6-25(4,5)24(28)30-21-12-15(2)11-17-8-7-16(3)20(23(17)21)10-9-19-13-18(26)14-22(27)29-19/h7-8,11,15-16,18-21,23,26H,6,9-10,12-14H2,1-5H3/t15-,16-,18+,19+,20-,21-,23-/m0/s1 |
| InChIKey | RYMZZMVNJRMUDD-HGQWONQESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor An EC 3.4.24.* (metalloendopeptidase) inhibitor that interferes with the action of anthrax lethal factor endopeptidase (EC 3.4.24.83). EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| simvastatin (CHEBI:9150) has functional parent lovastatin (CHEBI:40303) |
| simvastatin (CHEBI:9150) has role EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor (CHEBI:35664) |
| simvastatin (CHEBI:9150) has role EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor (CHEBI:77255) |
| simvastatin (CHEBI:9150) has role ferroptosis inducer (CHEBI:173085) |
| simvastatin (CHEBI:9150) has role geroprotector (CHEBI:176497) |
| simvastatin (CHEBI:9150) has role prodrug (CHEBI:50266) |
| simvastatin (CHEBI:9150) is a fatty acid ester (CHEBI:35748) |
| simvastatin (CHEBI:9150) is a hexahydronaphthalenes (CHEBI:142348) |
| simvastatin (CHEBI:9150) is a statin (semi-synthetic) (CHEBI:87633) |
| simvastatin (CHEBI:9150) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1S,3R,7S,8S,8aR)-8-{2-[(2R,4R)-4-hydroxy-6-oxotetrahydro-2H-pyran-2-yl]ethyl}-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl 2,2-dimethylbutanoate |
| INN | Source |
|---|---|
| simvastatin | DrugBank |
| Synonyms | Source |
|---|---|
| 2,2-dimethylbutyric acid, 8-ester with (4R,6R)-6-(2-((1S,2S,6R,8S,8aR)-1,2,6,7,8,8a-hexahydro-8-hydroxy-2,6-dimethyl-1-naphthyl)ethyl)tetrahydro-4-hydroxy-2H-pyran-2-one | ChemIDplus |
| MK-733 | KEGG DRUG |
| Simvastatin | KEGG DRUG |
| Simvastatina | ChemIDplus |
| Simvastatine | ChemIDplus |
| Simvastatinum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2445 | DrugCentral |
| D00434 | KEGG DRUG |
| DB00641 | DrugBank |
| EP33538 | Patent |
| HMDB0005007 | HMDB |
| LSM-2492 | LINCS |
| Simvastatin | Wikipedia |
| US4444784 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4768037 | Beilstein |
| CAS:79902-63-9 | ChemIDplus |
| CAS:79902-63-9 | KEGG DRUG |
| Citations |
|---|