EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC(C)=CCC/C(C)=C/CO |
| InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7+ |
| InChIKey | GLZPCOQZEFWAFX-JXMROGBWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geraniol (CHEBI:17447) has role allergen (CHEBI:50904) |
| geraniol (CHEBI:17447) has role fragrance (CHEBI:48318) |
| geraniol (CHEBI:17447) has role plant metabolite (CHEBI:76924) |
| geraniol (CHEBI:17447) has role volatile oil component (CHEBI:27311) |
| geraniol (CHEBI:17447) is a 3,7-dimethylocta-2,6-dien-1-ol (CHEBI:24221) |
| geraniol (CHEBI:17447) is a monoterpenoid (CHEBI:25409) |
| geraniol (CHEBI:17447) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| (E)-2-methylgeranyl diphosphate (CHEBI:61982) has functional parent geraniol (CHEBI:17447) |
| (E)-geranyl formate (CHEBI:31648) has functional parent geraniol (CHEBI:17447) |
| (2E)-geranyl hexadecanoate (CHEBI:235328) has functional parent geraniol (CHEBI:17447) |
| geranyl acetate (CHEBI:5331) has functional parent geraniol (CHEBI:17447) |
| geranyl acetoacetate (CHEBI:85255) has functional parent geraniol (CHEBI:17447) |
| geranyl benzoate (CHEBI:156234) has functional parent geraniol (CHEBI:17447) |
| geranyl diphosphate (CHEBI:17211) has functional parent geraniol (CHEBI:17447) |
| geranyl phosphate (CHEBI:90159) has functional parent geraniol (CHEBI:17447) |
| IUPAC Name |
|---|
| (2E)-3,7-dimethylocta-2,6-dien-1-ol |
| Synonyms | Source |
|---|---|
| (2E)-3,7-dimethyl-2,6-octadien-1-ol | NIST Chemistry WebBook |
| 2-trans-3,7-Dimethyl-2,6-octadien-1-ol | ChemIDplus |
| 3,7-dimethyl-trans-2,6-octadien-1-ol | ChemIDplus |
| Geraniol | KEGG COMPOUND |
| geranyl alcohol | ChemIDplus |
| (E)-3,7-dimethyl-2,6-octadien-1-ol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (2E)-geraniol | UniProt |
| Citations |
|---|