EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17447 - geraniol
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC(C)=CCC/C(C)=C/CO |
| InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7+ |
| InChIKey | GLZPCOQZEFWAFX-JXMROGBWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geraniol (CHEBI:17447) has role allergen (CHEBI:50904) |
| geraniol (CHEBI:17447) has role fragrance (CHEBI:48318) |
| geraniol (CHEBI:17447) has role plant metabolite (CHEBI:76924) |
| geraniol (CHEBI:17447) has role volatile oil component (CHEBI:27311) |
| geraniol (CHEBI:17447) is a 3,7-dimethylocta-2,6-dien-1-ol (CHEBI:24221) |
| geraniol (CHEBI:17447) is a monoterpenoid (CHEBI:25409) |
| geraniol (CHEBI:17447) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| (E)-2-methylgeranyl diphosphate (CHEBI:61982) has functional parent geraniol (CHEBI:17447) |
| (E)-geranyl formate (CHEBI:31648) has functional parent geraniol (CHEBI:17447) |
| (2E)-geranyl hexadecanoate (CHEBI:235328) has functional parent geraniol (CHEBI:17447) |
| geranyl acetate (CHEBI:5331) has functional parent geraniol (CHEBI:17447) |
| geranyl acetoacetate (CHEBI:85255) has functional parent geraniol (CHEBI:17447) |
| geranyl benzoate (CHEBI:156234) has functional parent geraniol (CHEBI:17447) |
| geranyl diphosphate (CHEBI:17211) has functional parent geraniol (CHEBI:17447) |
| geranyl phosphate (CHEBI:90159) has functional parent geraniol (CHEBI:17447) |
| IUPAC Name |
|---|
| (2E)-3,7-dimethylocta-2,6-dien-1-ol |
| Synonyms | Source |
|---|---|
| (2E)-3,7-dimethyl-2,6-octadien-1-ol | NIST Chemistry WebBook |
| 2-trans-3,7-Dimethyl-2,6-octadien-1-ol | ChemIDplus |
| 3,7-dimethyl-trans-2,6-octadien-1-ol | ChemIDplus |
| Geraniol | KEGG COMPOUND |
| geranyl alcohol | ChemIDplus |
| (E)-3,7-dimethyl-2,6-octadien-1-ol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (2E)-geraniol | UniProt |
| Citations |
|---|