EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22O7P2 |
| Net Charge | 0 |
| Average Mass | 328.238 |
| Monoisotopic Mass | 328.08408 |
| SMILES | CC(C)=CCC/C(C)=C(\C)COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C11H22O7P2/c1-9(2)6-5-7-10(3)11(4)8-17-20(15,16)18-19(12,13)14/h6H,5,7-8H2,1-4H3,(H,15,16)(H2,12,13,14)/b11-10+ |
| InChIKey | PRUWPPRJQIGKNB-ZHACJKMWSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-2-methylgeranyl diphosphate (CHEBI:61982) has functional parent geraniol (CHEBI:17447) |
| (E)-2-methylgeranyl diphosphate (CHEBI:61982) is a alkyl diphosphate (CHEBI:46731) |
| (E)-2-methylgeranyl diphosphate (CHEBI:61982) is conjugate acid of (E)-2-methylgeranyl diphosphate(3−) (CHEBI:61984) |
| Incoming Relation(s) |
| (E)-2-methylgeranyl diphosphate(3−) (CHEBI:61984) is conjugate base of (E)-2-methylgeranyl diphosphate (CHEBI:61982) |
| IUPAC Name |
|---|
| (2E)-2,3,7-trimethylocta-2,6-dien-1-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| (E)-2-methylgeranyl pyrophosphate | ChEBI |
| 2-MeGPP | ChEBI |
| (E)-2-methyl-GPP | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18894816 | Reaxys |
| Citations |
|---|