EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17211 - geranyl diphosphate
| Formula | C10H20O7P2 |
| Net Charge | 0 |
| Average Mass | 314.211 |
| Monoisotopic Mass | 314.06843 |
| SMILES | CC(C)=CCC/C(C)=C/COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H20O7P2/c1-9(2)5-4-6-10(3)7-8-16-19(14,15)17-18(11,12)13/h5,7H,4,6,8H2,1-3H3,(H,14,15)(H2,11,12,13)/b10-7+ |
| InChIKey | GVVPGTZRZFNKDS-JXMROGBWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geranyl diphosphate (CHEBI:17211) has functional parent geraniol (CHEBI:17447) |
| geranyl diphosphate (CHEBI:17211) has role Escherichia coli metabolite (CHEBI:76971) |
| geranyl diphosphate (CHEBI:17211) has role mouse metabolite (CHEBI:75771) |
| geranyl diphosphate (CHEBI:17211) is a polyprenyl diphosphate (CHEBI:37531) |
| geranyl diphosphate (CHEBI:17211) is conjugate acid of geranyl diphosphate(3−) (CHEBI:58057) |
| Incoming Relation(s) |
| geranyl diphosphate(3−) (CHEBI:58057) is conjugate base of geranyl diphosphate (CHEBI:17211) |
| IUPAC Name |
|---|
| (2E)-3,7-dimethylocta-2,6-dien-1-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| Geranyl diphosphate | KEGG COMPOUND |
| GERANYL DIPHOSPHATE | PDBeChem |
| geranyl pyrophosphate | ChemIDplus |
| Citations |
|---|