EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18O2 |
| Net Charge | 0 |
| Average Mass | 182.263 |
| Monoisotopic Mass | 182.13068 |
| SMILES | [H]C(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C11H18O2/c1-10(2)5-4-6-11(3)7-8-13-9-12/h5,7,9H,4,6,8H2,1-3H3/b11-7+ |
| InChIKey | FQMZVFJYMPNUCT-YRNVUSSQSA-N |
| Roles Classification |
|---|
| Biological Roles: | alarm pheromone A pheromone which is released by an organism when damaged by a predator which warns other individuals that there is a danger. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-geranyl formate (CHEBI:31648) has functional parent geraniol (CHEBI:17447) |
| (E)-geranyl formate (CHEBI:31648) has role alarm pheromone (CHEBI:72575) |
| (E)-geranyl formate (CHEBI:31648) has role plant metabolite (CHEBI:76924) |
| (E)-geranyl formate (CHEBI:31648) is a formate ester (CHEBI:52343) |
| IUPAC Name |
|---|
| (2E)-3,7-dimethylocta-2,6-dien-1-yl formate |
| Synonyms | Source |
|---|---|
| Geranyl formate | KEGG COMPOUND |
| (2E)-3,7-dimethyl-2,6-octadien-1-ol, 1-formate | ChemIDplus |
| Formic acid, geraniol ester | ChemIDplus |
| Geraniol formate | ChemIDplus |
| Geranyl methanoate | ChemIDplus |
| trans-3,7-Dimethyl-2,6-octadien-1-yl formate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C12294 | KEGG COMPOUND |
| HMDB0035156 | HMDB |
| Citations |
|---|