EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O2 |
| Net Charge | 0 |
| Average Mass | 258.361 |
| Monoisotopic Mass | 258.16198 |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H22O2/c1-14(2)8-7-9-15(3)12-13-19-17(18)16-10-5-4-6-11-16/h4-6,8,10-12H,7,9,13H2,1-3H3/b15-12+ |
| InChIKey | YDVXYTIIPGKIJP-NTCAYCPXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gardenia taitensis (ncbitaxon:83587) | - | DOI (10.1080/10412905.1992.9698082) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geranyl benzoate (CHEBI:156234) has functional parent benzoic acid (CHEBI:30746) |
| geranyl benzoate (CHEBI:156234) has functional parent geraniol (CHEBI:17447) |
| geranyl benzoate (CHEBI:156234) has role fragrance (CHEBI:48318) |
| geranyl benzoate (CHEBI:156234) has role plant metabolite (CHEBI:76924) |
| geranyl benzoate (CHEBI:156234) is a benzoate ester (CHEBI:36054) |
| geranyl benzoate (CHEBI:156234) is a monoterpenoid (CHEBI:25409) |
| geranyl benzoate (CHEBI:156234) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (2E)-3,7-dimethylocta-2,6-dien-1-yl benzoate |
| Synonyms | Source |
|---|---|
| benzoic acid geraniol ester | ChemIDplus |
| benzoic acid, geraniol ester | ChemIDplus |
| benzoic acid geranyl ester | ChemIDplus |
| geraniol benzoate | ChemIDplus |
| trans-3,7-dimethyl-2,6-octadien-1-yl benzoate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (2E)-geranyl benzoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| FDB011520 | FooDB |
| HMDB0033478 | HMDB |
| Citations |
|---|