EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O2 |
| Net Charge | 0 |
| Average Mass | 196.290 |
| Monoisotopic Mass | 196.14633 |
| SMILES | CC(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C12H20O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,8H,5,7,9H2,1-4H3/b11-8+ |
| InChIKey | HIGQPQRQIQDZMP-DHZHZOJOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geranyl acetate (CHEBI:5331) has functional parent geraniol (CHEBI:17447) |
| geranyl acetate (CHEBI:5331) has role plant metabolite (CHEBI:76924) |
| geranyl acetate (CHEBI:5331) is a acetate ester (CHEBI:47622) |
| geranyl acetate (CHEBI:5331) is a monoterpenoid (CHEBI:25409) |
| IUPAC Name |
|---|
| (2E)-3,7-dimethylocta-2,6-dien-1-yl acetate |
| Synonym | Source |
|---|---|
| trans-3,7-dimethyl-2,6-octadien-1-yl acetate | ChEBI |
| UniProt Name | Source |
|---|---|
| (2E)-geranyl acetate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C09861 | KEGG COMPOUND |
| C00003046 | KNApSAcK |
| CPD-9758 | MetaCyc |
| HMDB0035157 | HMDB |
| Geranyl_acetate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722815 | Reaxys |
| CAS:105-87-3 | KEGG COMPOUND |
| CAS:105-87-3 | NIST Chemistry WebBook |
| Citations |
|---|