EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O7 |
| Net Charge | 0 |
| Average Mass | 192.123 |
| Monoisotopic Mass | 192.02700 |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. calcium chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central calcium atom at two or more points. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Application: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citric acid (CHEBI:30769) has role antimicrobial agent (CHEBI:33281) |
| citric acid (CHEBI:30769) has role calcium chelator (CHEBI:232436) |
| citric acid (CHEBI:30769) has role chelator (CHEBI:38161) |
| citric acid (CHEBI:30769) has role food acidity regulator (CHEBI:64049) |
| citric acid (CHEBI:30769) has role fundamental metabolite (CHEBI:78675) |
| citric acid (CHEBI:30769) is a tricarboxylic acid (CHEBI:27093) |
| citric acid (CHEBI:30769) is conjugate acid of citrate anion (CHEBI:133748) |
| citric acid (CHEBI:30769) is conjugate acid of citrate(1−) (CHEBI:35804) |
| Incoming Relation(s) |
| (3S)-citryl-CoA (CHEBI:15459) has functional parent citric acid (CHEBI:30769) |
| Nα-citryl-Nε-acetyl-Nε-hydroxylysine (CHEBI:63801) has functional parent citric acid (CHEBI:30769) |
| 2-[(L-alanin-3-ylcarbamoyl)methyl]-2-hydroxybutanedioate(2−) (CHEBI:142969) has functional parent citric acid (CHEBI:30769) |
| 2-methylcitric acid (CHEBI:30835) has functional parent citric acid (CHEBI:30769) |
| iron(III) dicitrate(3−) (CHEBI:4991) has functional parent citric acid (CHEBI:30769) |
| rhizobactin 1021 (CHEBI:74252) has functional parent citric acid (CHEBI:30769) |
| schizokinen (CHEBI:84582) has functional parent citric acid (CHEBI:30769) |
| staphyloferrin A (CHEBI:84711) has functional parent citric acid (CHEBI:30769) |
| staphyloferrin B (CHEBI:134612) has functional parent citric acid (CHEBI:30769) |
| vibrioferrin (CHEBI:84585) has functional parent citric acid (CHEBI:30769) |
| β-citryl-Glu-Glu (CHEBI:90168) has functional parent citric acid (CHEBI:30769) |
| β-citrylglutamic acid (CHEBI:77065) has functional parent citric acid (CHEBI:30769) |
| Anaerocult™ (CHEBI:82659) has part citric acid (CHEBI:30769) |
| citrate anion (CHEBI:133748) is conjugate base of citric acid (CHEBI:30769) |
| citrate(1−) (CHEBI:35804) is conjugate base of citric acid (CHEBI:30769) |
| IUPAC Name |
|---|
| 2-hydroxypropane-1,2,3-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-1,2,3-propanetricarboxylic acid | KEGG COMPOUND |
| 2-Hydroxytricarballylic acid | KEGG COMPOUND |
| 3-Carboxy-3-hydroxypentane-1,5-dioic acid | HMDB |
| Citric acid | KEGG COMPOUND |
| CITRIC ACID | PDBeChem |
| Citronensäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1359 | BPDB |
| 666 | DrugCentral |
| C00007619 | KNApSAcK |
| C00158 | KEGG COMPOUND |
| CIT | PDBeChem |
| CIT | MetaCyc |
| Citric_Acid | Wikipedia |
| D00037 | KEGG DRUG |
| DB04272 | DrugBank |
| HMDB0000094 | HMDB |
| Citations |
|---|