EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O7 |
| Net Charge | 0 |
| Average Mass | 192.123 |
| Monoisotopic Mass | 192.02700 |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | calcium chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central calcium atom at two or more points. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. fundamental metabolite Any metabolite produced by all living cells. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citric acid (CHEBI:30769) has role antimicrobial agent (CHEBI:33281) |
| citric acid (CHEBI:30769) has role calcium chelator (CHEBI:232436) |
| citric acid (CHEBI:30769) has role chelator (CHEBI:38161) |
| citric acid (CHEBI:30769) has role food acidity regulator (CHEBI:64049) |
| citric acid (CHEBI:30769) has role fundamental metabolite (CHEBI:78675) |
| citric acid (CHEBI:30769) is a tricarboxylic acid (CHEBI:27093) |
| citric acid (CHEBI:30769) is conjugate acid of citrate anion (CHEBI:133748) |
| citric acid (CHEBI:30769) is conjugate acid of citrate(1−) (CHEBI:35804) |
| Incoming Relation(s) |
| (3S)-citryl-CoA (CHEBI:15459) has functional parent citric acid (CHEBI:30769) |
| Nα-citryl-Nε-acetyl-Nε-hydroxylysine (CHEBI:63801) has functional parent citric acid (CHEBI:30769) |
| 2-[(L-alanin-3-ylcarbamoyl)methyl]-2-hydroxybutanedioate(2−) (CHEBI:142969) has functional parent citric acid (CHEBI:30769) |
| 2-methylcitric acid (CHEBI:30835) has functional parent citric acid (CHEBI:30769) |
| iron(III) dicitrate(3−) (CHEBI:4991) has functional parent citric acid (CHEBI:30769) |
| rhizobactin 1021 (CHEBI:74252) has functional parent citric acid (CHEBI:30769) |
| schizokinen (CHEBI:84582) has functional parent citric acid (CHEBI:30769) |
| staphyloferrin A (CHEBI:84711) has functional parent citric acid (CHEBI:30769) |
| staphyloferrin B (CHEBI:134612) has functional parent citric acid (CHEBI:30769) |
| vibrioferrin (CHEBI:84585) has functional parent citric acid (CHEBI:30769) |
| β-citryl-Glu-Glu (CHEBI:90168) has functional parent citric acid (CHEBI:30769) |
| β-citrylglutamic acid (CHEBI:77065) has functional parent citric acid (CHEBI:30769) |
| Anaerocult™ (CHEBI:82659) has part citric acid (CHEBI:30769) |
| citrate anion (CHEBI:133748) is conjugate base of citric acid (CHEBI:30769) |
| citrate(1−) (CHEBI:35804) is conjugate base of citric acid (CHEBI:30769) |
| IUPAC Name |
|---|
| 2-hydroxypropane-1,2,3-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-1,2,3-propanetricarboxylic acid | KEGG COMPOUND |
| 2-Hydroxytricarballylic acid | KEGG COMPOUND |
| 3-Carboxy-3-hydroxypentane-1,5-dioic acid | HMDB |
| Citric acid | KEGG COMPOUND |
| CITRIC ACID | PDBeChem |
| Citronensäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1359 | BPDB |
| 666 | DrugCentral |
| C00007619 | KNApSAcK |
| C00158 | KEGG COMPOUND |
| CIT | PDBeChem |
| CIT | MetaCyc |
| Citric_Acid | Wikipedia |
| D00037 | KEGG DRUG |
| DB04272 | DrugBank |
| HMDB0000094 | HMDB |
| Citations |
|---|