EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO10 |
| Net Charge | 0 |
| Average Mass | 321.238 |
| Monoisotopic Mass | 321.06960 |
| SMILES | O=C(O)CC[C@H](NC(=O)C(O)(CC(=O)O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H15NO10/c13-6(14)2-1-5(9(19)20)12-10(21)11(22,3-7(15)16)4-8(17)18/h5,22H,1-4H2,(H,12,21)(H,13,14)(H,15,16)(H,17,18)(H,19,20)/t5-/m0/s1 |
| InChIKey | GAQNUGISBQJMKO-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-citrylglutamic acid (CHEBI:77065) has functional parent citric acid (CHEBI:30769) |
| β-citrylglutamic acid (CHEBI:77065) has role human metabolite (CHEBI:77746) |
| β-citrylglutamic acid (CHEBI:77065) has role iron chelator (CHEBI:38157) |
| β-citrylglutamic acid (CHEBI:77065) is a N-acyl-L-glutamic acid (CHEBI:21650) |
| β-citrylglutamic acid (CHEBI:77065) is a tetracarboxylic acid (CHEBI:35742) |
| IUPAC Name |
|---|
| N-[3-carboxy-2-(carboxymethyl)-2-hydroxypropanoyl]-L-glutamic acid |
| Synonyms | Source |
|---|---|
| beta-CG | HMDB |
| beta-Citrylglutamic acid | ChemIDplus |
| beta-Citryl-L-glutamic acid | ChemIDplus |
| β-citryl-L-glutamic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013220 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:69281-09-0 | ChemIDplus |
| Citations |
|---|