EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N4O11 |
| Net Charge | 0 |
| Average Mass | 448.385 |
| Monoisotopic Mass | 448.14416 |
| SMILES | N[C@@H](CNC(=O)C[C@@](O)(CC(=O)NCCNC(=O)CCC(=O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H24N4O11/c17-8(13(25)26)7-20-12(24)6-16(31,15(29)30)5-11(23)19-4-3-18-10(22)2-1-9(21)14(27)28/h8,31H,1-7,17H2,(H,18,22)(H,19,23)(H,20,24)(H,25,26)(H,27,28)(H,29,30)/t8-,16-/m0/s1 |
| InChIKey | SIAZVTIHOHTZDD-PWJLMRLQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylococcus aureus (ncbitaxon:1280) | - | PubMed (26030732) | |
| Staphylococcus hyicus (ncbitaxon:1284) | - | PubMed (8138126) |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| staphyloferrin B (CHEBI:134612) has functional parent citric acid (CHEBI:30769) |
| staphyloferrin B (CHEBI:134612) has role bacterial metabolite (CHEBI:76969) |
| staphyloferrin B (CHEBI:134612) has role siderophore (CHEBI:26672) |
| staphyloferrin B (CHEBI:134612) is a oxo carboxylic acid (CHEBI:25754) |
| staphyloferrin B (CHEBI:134612) is a tertiary alcohol (CHEBI:26878) |
| staphyloferrin B (CHEBI:134612) is a tricarboxylic acid (CHEBI:27093) |
| staphyloferrin B (CHEBI:134612) is a tricarboxylic acid amide (CHEBI:50665) |
| staphyloferrin B (CHEBI:134612) is conjugate acid of staphyloferrin B(2−) (CHEBI:136993) |
| Incoming Relation(s) |
| staphyloferrin B(2−) (CHEBI:136993) is conjugate base of staphyloferrin B (CHEBI:134612) |
| IUPAC Name |
|---|
| 5-[(2-{[(3S)-5-{[(2S)-2-amino-2-carboxyethyl]amino}-3-carboxy-3-hydroxy-5-oxopentanoyl]amino}ethyl)amino]-2,5-dioxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-12590 | MetaCyc |
| Citations |
|---|