EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28N4O9 |
| Net Charge | 0 |
| Average Mass | 420.419 |
| Monoisotopic Mass | 420.18563 |
| SMILES | CC(=O)N(O)CCCNC(=O)CC(O)(CC(=O)NCCCN(O)C(C)=O)C(=O)O |
| InChI | InChI=1S/C16H28N4O9/c1-11(21)19(28)7-3-5-17-13(23)9-16(27,15(25)26)10-14(24)18-6-4-8-20(29)12(2)22/h27-29H,3-10H2,1-2H3,(H,17,23)(H,18,24)(H,25,26) |
| InChIKey | YILWWVUXGMGOAM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anabaena sp. (ncbitaxon:1167) | - | PubMed (6806241) | Strain: ATCC 27898 |
| Bacillus megaterium (ncbitaxon:1404) | - | PubMed (4960152) | Strain: ATCC 19213 |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| schizokinen (CHEBI:84582) has functional parent citric acid (CHEBI:30769) |
| schizokinen (CHEBI:84582) has role bacterial metabolite (CHEBI:76969) |
| schizokinen (CHEBI:84582) has role siderophore (CHEBI:26672) |
| schizokinen (CHEBI:84582) is a 2-hydroxy carboxylic acid (CHEBI:52618) |
| schizokinen (CHEBI:84582) is a hydroxamic acid (CHEBI:24650) |
| IUPAC Name |
|---|
| 4-({3-[acetyl(hydroxy)amino]propyl}amino)-2-[2-({3-[acetyl(hydroxy)amino]propyl}amino)-2-oxoethyl]-2-hydroxy-4-oxobutanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2492423 | Reaxys |
| CAS:35418-52-1 | ChemIDplus |
| Citations |
|---|