EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N2O14 |
| Net Charge | 0 |
| Average Mass | 480.379 |
| Monoisotopic Mass | 480.12275 |
| SMILES | O=C(O)CC(O)(CC(=O)NCCC[C@@H](NC(=O)CC(O)(CC(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H24N2O14/c20-9(4-16(32,14(28)29)6-11(22)23)18-3-1-2-8(13(26)27)19-10(21)5-17(33,15(30)31)7-12(24)25/h8,32-33H,1-7H2,(H,18,20)(H,19,21)(H,22,23)(H,24,25)(H,26,27)(H,28,29)(H,30,31)/t8-,16?,17?/m1/s1 |
| InChIKey | VJSIXUQLTJCRCS-PJPOUAMNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylococcus hyicus (ncbitaxon:1284) | - | PubMed (2379505) | Strain: DSM 20459 |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| staphyloferrin A (CHEBI:84711) has functional parent citric acid (CHEBI:30769) |
| staphyloferrin A (CHEBI:84711) has role bacterial metabolite (CHEBI:76969) |
| staphyloferrin A (CHEBI:84711) has role siderophore (CHEBI:26672) |
| staphyloferrin A (CHEBI:84711) is a D-ornithine derivative (CHEBI:84714) |
| staphyloferrin A (CHEBI:84711) is a pentacarboxylic acid (CHEBI:35743) |
| staphyloferrin A (CHEBI:84711) is a tertiary alcohol (CHEBI:26878) |
| staphyloferrin A (CHEBI:84711) is a tricarboxylic acid amide (CHEBI:50665) |
| staphyloferrin A (CHEBI:84711) is conjugate acid of staphyloferrin A(5−) (CHEBI:142973) |
| Incoming Relation(s) |
| N5-[(S)-citryl]-D-ornithine(2−) (CHEBI:142972) has functional parent staphyloferrin A (CHEBI:84711) |
| staphyloferrin A(5−) (CHEBI:142973) is conjugate base of staphyloferrin A (CHEBI:84711) |
| IUPAC Name |
|---|
| 2-[2-({(1R)-1-carboxy-4-[(3,4-dicarboxy-3-hydroxybutanoyl)amino]butyl}amino)-2-oxoethyl]-2-hydroxysuccinic acid |
| Synonym | Source |
|---|---|
| N2,N5-di-(1-oxo-3-hydroxy-3,4-dicarboxybutyl)-D-ornithine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-12589 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26649296 | Reaxys |
| CAS:127902-98-1 | ChemIDplus |
| Citations |
|---|