EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22N2O12 |
| Net Charge | 0 |
| Average Mass | 434.354 |
| Monoisotopic Mass | 434.11727 |
| SMILES | C[C@@H](C(=O)NCCOC(=O)C[C@](O)(CC(=O)O)C(=O)O)N1C(=O)CCC1(O)C(=O)O |
| InChI | InChI=1S/C16H22N2O12/c1-8(18-9(19)2-3-16(18,29)14(26)27)12(23)17-4-5-30-11(22)7-15(28,13(24)25)6-10(20)21/h8,28-29H,2-7H2,1H3,(H,17,23)(H,20,21)(H,24,25)(H,26,27)/t8-,15+,16?/m0/s1 |
| InChIKey | IGQXNKDXMPSELX-BIAKFKOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vibrio alginolyticus (ncbitaxon:663) | - | PubMed (22146715) | |
| Vibrio parahaemolyticus (ncbitaxon:670) | - | DOI (DOI: 10.1111/j.1574-6968.1992.tb05311.x) | Strain: AQ 3354 |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vibrioferrin (CHEBI:84585) has functional parent citric acid (CHEBI:30769) |
| vibrioferrin (CHEBI:84585) has role marine metabolite (CHEBI:76507) |
| vibrioferrin (CHEBI:84585) has role siderophore (CHEBI:26672) |
| vibrioferrin (CHEBI:84585) is a N-acyl hemiaminal (CHEBI:142734) |
| vibrioferrin (CHEBI:84585) is a carboxylic ester (CHEBI:33308) |
| vibrioferrin (CHEBI:84585) is a pyrrolidin-2-ones (CHEBI:74223) |
| vibrioferrin (CHEBI:84585) is a tertiary alcohol (CHEBI:26878) |
| vibrioferrin (CHEBI:84585) is a tricarboxylic acid (CHEBI:27093) |
| vibrioferrin (CHEBI:84585) is conjugate acid of vibrioferrin(3−) (CHEBI:84630) |
| Incoming Relation(s) |
| vibrioferrin(3−) (CHEBI:84630) is conjugate base of vibrioferrin (CHEBI:84585) |
| IUPAC Name |
|---|
| (2R)-2-[2-(2-{[(2S)-2-(2-carboxy-2-hydroxy-5-oxopyrrolidin-1-yl)propanoyl]amino}ethoxy)-2-oxoethyl]-2-hydroxysuccinic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8368063 | Reaxys |
| CAS:157568-17-7 | ChemIDplus |
| Citations |
|---|