EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22N2O13 |
| Net Charge | 0 |
| Average Mass | 450.353 |
| Monoisotopic Mass | 450.11219 |
| SMILES | O=C(O)CC[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)C(O)(CC(=O)O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H22N2O13/c19-9(20)3-1-7(13(27)17-8(14(28)29)2-4-10(21)22)18-15(30)16(31,5-11(23)24)6-12(25)26/h7-8,31H,1-6H2,(H,17,27)(H,18,30)(H,19,20)(H,21,22)(H,23,24)(H,25,26)(H,28,29)/t7-,8-/m0/s1 |
| InChIKey | JVZWBVAMDACIET-YUMQZZPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS197) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-citryl-Glu-Glu (CHEBI:90168) has functional parent citric acid (CHEBI:30769) |
| β-citryl-Glu-Glu (CHEBI:90168) has functional parent Glu-Glu (CHEBI:5390) |
| β-citryl-Glu-Glu (CHEBI:90168) is a dipeptide (CHEBI:46761) |
| β-citryl-Glu-Glu (CHEBI:90168) is conjugate acid of β-citryl-L-glutamyl-L-glutamate (CHEBI:167458) |
| Incoming Relation(s) |
| β-citryl-L-glutamyl-L-glutamate (CHEBI:167458) is conjugate base of β-citryl-Glu-Glu (CHEBI:90168) |
| IUPAC Name |
|---|
| L-[3-carboxy-2-(carboxymethyl)-2-hydroxypropanoyl]-L-α-glutamyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| β-citryl-L-glutamyl-L-glutamic acid | ChEBI |
| β-citryl-L-Glu-L-Glu | ChEBI |